Maackiaflavanone
Internal ID | 8f9c34a7-7aae-4a74-b98a-0bd23e8c78cf |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | 2-[2,4-dihydroxy-5-(3-methylbut-2-enyl)phenyl]-5-hydroxy-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=CC(=C(C=C1O)O)C2CC(=O)C3=C(O2)C(=C(C=C3O)OC)CC=C(C)C)C |
SMILES (Isomeric) | CC(=CCC1=CC(=C(C=C1O)O)C2CC(=O)C3=C(O2)C(=C(C=C3O)OC)CC=C(C)C)C |
InChI | InChI=1S/C26H30O6/c1-14(2)6-8-16-10-18(20(28)11-19(16)27)24-13-22(30)25-21(29)12-23(31-5)17(26(25)32-24)9-7-15(3)4/h6-7,10-12,24,27-29H,8-9,13H2,1-5H3 |
InChI Key | DVNXMSLAHMVXOH-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C26H30O6 |
Molecular Weight | 438.50 g/mol |
Exact Mass | 438.20423867 g/mol |
Topological Polar Surface Area (TPSA) | 96.20 Ų |
XlogP | 6.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.23% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.39% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.85% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 93.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.29% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.70% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.73% | 95.56% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 90.63% | 92.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.65% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.48% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.12% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.11% | 89.50% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 85.73% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.93% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 84.86% | 98.75% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.82% | 99.23% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.45% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.73% | 94.73% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.16% | 91.07% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.95% | 93.40% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.27% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.27% | 96.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 80.15% | 92.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Maackia amurensis |
PubChem | 42608032 |
LOTUS | LTS0133502 |
wikiData | Q104400375 |