Luzonoside A
Internal ID | d3af40a2-7068-4271-9ffb-af526e24e0a5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,6S,7R,7aS)-7-hydroxy-7-(hydroxymethyl)-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-4a,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC(C)CC(=O)OC1C2C(CC(C2(CO)O)OC(=O)C=CC3=CC=C(C=C3)O)C(=CO1)COC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | CC(C)CC(=O)O[C@H]1[C@H]2[C@H](C[C@@H]([C@@]2(CO)O)OC(=O)/C=C/C3=CC=C(C=C3)O)C(=CO1)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C30H40O14/c1-15(2)9-23(35)44-28-24-19(17(12-40-28)13-41-29-27(38)26(37)25(36)20(11-31)42-29)10-21(30(24,39)14-32)43-22(34)8-5-16-3-6-18(33)7-4-16/h3-8,12,15,19-21,24-29,31-33,36-39H,9-11,13-14H2,1-2H3/b8-5+/t19-,20-,21+,24-,25-,26+,27-,28+,29-,30-/m1/s1 |
InChI Key | VUZLGISBPIEZOX-HJBLAVRFSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C30H40O14 |
Molecular Weight | 624.60 g/mol |
Exact Mass | 624.24180595 g/mol |
Topological Polar Surface Area (TPSA) | 222.00 Ų |
XlogP | -0.40 |
SCHEMBL421813 |
CHEMBL510787 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.77% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.37% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.83% | 97.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 96.61% | 95.93% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.79% | 83.82% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.58% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.41% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.30% | 89.00% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 92.11% | 97.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.92% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.72% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 88.86% | 98.95% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 88.49% | 98.35% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.15% | 95.89% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.83% | 89.62% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.52% | 99.17% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 85.75% | 97.79% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.37% | 97.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.25% | 95.89% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 82.89% | 89.67% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.68% | 90.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.62% | 92.50% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.48% | 85.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.37% | 95.50% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 80.96% | 94.97% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.47% | 86.92% |
CHEMBL268 | P43235 | Cathepsin K | 80.30% | 96.85% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.05% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Viburnum luzonicum |
PubChem | 11319570 |
LOTUS | LTS0190162 |
wikiData | Q105297529 |