Lumizinone A
| Internal ID | 5d127ae2-190d-4125-9b85-3b179f29976c |
| Taxonomy | Benzenoids > Phenols > 1-hydroxy-2-unsubstituted benzenoids |
| IUPAC Name | 6-[(4-hydroxyphenyl)methyl]-3-(2-methylpropyl)-1H-pyrazin-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H18N2O2/c1-10(2)7-14-15(19)17-12(9-16-14)8-11-3-5-13(18)6-4-11/h3-6,9-10,18H,7-8H2,1-2H3,(H,17,19) |
| InChI Key | QHLKSESIIKJUHS-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.136827821 g/mol |
| Topological Polar Surface Area (TPSA) | 61.70 Ų |
| XlogP | 2.10 |
| SCHEMBL20204670 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.41% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.80% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.77% | 98.75% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 91.32% | 95.50% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.28% | 85.14% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.06% | 93.10% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.01% | 90.08% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.46% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.35% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.03% | 94.73% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.02% | 94.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.72% | 99.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.67% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.44% | 94.45% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 83.71% | 92.29% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 83.09% | 99.23% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.69% | 85.00% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 82.03% | 94.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.58% | 90.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.57% | 90.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.37% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132599737 |
| LOTUS | LTS0213063 |
| wikiData | Q104195825 |