Luminmycin A
Internal ID | 702d4ac6-2c69-4794-96a0-c164af0f5247 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
IUPAC Name | (2E,4E)-N-[(2S,3R)-3-hydroxy-1-[[(3E,5S,8S)-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino]-1-oxobutan-2-yl]dodeca-2,4-dienamide |
SMILES (Canonical) | CCCCCCCC=CC=CC(=O)NC(C(C)O)C(=O)NC1CCCCNC(=O)C=CC(NC1=O)C |
SMILES (Isomeric) | CCCCCCC/C=C/C=C/C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@H]1CCCCNC(=O)/C=C/[C@@H](NC1=O)C |
InChI | InChI=1S/C27H44N4O5/c1-4-5-6-7-8-9-10-11-12-16-24(34)31-25(21(3)32)27(36)30-22-15-13-14-19-28-23(33)18-17-20(2)29-26(22)35/h10-12,16-18,20-22,25,32H,4-9,13-15,19H2,1-3H3,(H,28,33)(H,29,35)(H,30,36)(H,31,34)/b11-10+,16-12+,18-17+/t20-,21+,22-,25-/m0/s1 |
InChI Key | CXVPCSSIDACGGV-SBSLBVBZSA-N |
Popularity | 5 references in papers |
Molecular Formula | C27H44N4O5 |
Molecular Weight | 504.70 g/mol |
Exact Mass | 504.33117052 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | 4.10 |
Atomic LogP (AlogP) | 2.17 |
H-Bond Acceptor | 5 |
H-Bond Donor | 5 |
Rotatable Bonds | 12 |
CHEMBL2146520 |
![2D Structure of Luminmycin A 2D Structure of Luminmycin A](https://plantaedb.com/storage/docs/compounds/2023/11/luminmycin-a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.7882 | 78.82% |
Caco-2 | - | 0.8787 | 87.87% |
Blood Brain Barrier | - | 0.7000 | 70.00% |
Human oral bioavailability | - | 0.5571 | 55.71% |
Subcellular localzation | Mitochondria | 0.6104 | 61.04% |
OATP2B1 inhibitior | - | 0.7130 | 71.30% |
OATP1B1 inhibitior | + | 0.8268 | 82.68% |
OATP1B3 inhibitior | + | 0.8901 | 89.01% |
MATE1 inhibitior | - | 0.9200 | 92.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.5250 | 52.50% |
P-glycoprotein inhibitior | + | 0.6647 | 66.47% |
P-glycoprotein substrate | + | 0.7387 | 73.87% |
CYP3A4 substrate | + | 0.6478 | 64.78% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8774 | 87.74% |
CYP3A4 inhibition | - | 0.7024 | 70.24% |
CYP2C9 inhibition | - | 0.8932 | 89.32% |
CYP2C19 inhibition | - | 0.9030 | 90.30% |
CYP2D6 inhibition | - | 0.8859 | 88.59% |
CYP1A2 inhibition | - | 0.8964 | 89.64% |
CYP2C8 inhibition | + | 0.4876 | 48.76% |
CYP inhibitory promiscuity | - | 0.9650 | 96.50% |
UGT catelyzed | + | 0.6000 | 60.00% |
Carcinogenicity (binary) | - | 0.8400 | 84.00% |
Carcinogenicity (trinary) | Non-required | 0.6474 | 64.74% |
Eye corrosion | - | 0.9852 | 98.52% |
Eye irritation | - | 0.9588 | 95.88% |
Skin irritation | - | 0.7590 | 75.90% |
Skin corrosion | - | 0.9357 | 93.57% |
Ames mutagenesis | - | 0.7600 | 76.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.4230 | 42.30% |
Micronuclear | + | 0.7300 | 73.00% |
Hepatotoxicity | - | 0.6250 | 62.50% |
skin sensitisation | - | 0.8759 | 87.59% |
Respiratory toxicity | + | 0.7556 | 75.56% |
Reproductive toxicity | + | 0.7444 | 74.44% |
Mitochondrial toxicity | + | 0.7250 | 72.50% |
Nephrotoxicity | - | 0.6841 | 68.41% |
Acute Oral Toxicity (c) | III | 0.7129 | 71.29% |
Estrogen receptor binding | + | 0.5561 | 55.61% |
Androgen receptor binding | + | 0.6363 | 63.63% |
Thyroid receptor binding | - | 0.5598 | 55.98% |
Glucocorticoid receptor binding | + | 0.5570 | 55.70% |
Aromatase binding | - | 0.6208 | 62.08% |
PPAR gamma | + | 0.5712 | 57.12% |
Honey bee toxicity | - | 0.9124 | 91.24% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.5791 | 57.91% |
Fish aquatic toxicity | + | 0.7474 | 74.74% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.47% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.03% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.30% | 91.11% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.29% | 93.56% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.44% | 92.88% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.77% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.60% | 90.17% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.30% | 99.17% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 93.08% | 93.03% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.44% | 94.45% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.16% | 90.08% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.22% | 100.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.87% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.86% | 97.09% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.49% | 96.47% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 89.97% | 89.34% |
CHEMBL299 | P17252 | Protein kinase C alpha | 88.81% | 98.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.17% | 89.00% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 87.74% | 96.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.70% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 86.81% | 92.50% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.76% | 94.66% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.72% | 94.33% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.41% | 91.81% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.15% | 92.62% |
CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 84.00% | 96.33% |
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 83.68% | 88.42% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 83.46% | 91.03% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 83.20% | 96.90% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.11% | 97.29% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 82.79% | 95.38% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 82.31% | 95.71% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.98% | 89.50% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.17% | 95.89% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 80.94% | 97.64% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.93% | 95.50% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 80.83% | 89.63% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.62% | 89.33% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.52% | 98.33% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 80.49% | 96.38% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.15% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Osteospermum muricatum |
Senecio subrubriflorus |
PubChem | 71452834 |
LOTUS | LTS0022715 |
wikiData | Q105379254 |