Luchunazine C
| Internal ID | 07167476-14e1-4af9-8cfe-b54df1696fca |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
| IUPAC Name | methyl 4-[3-acetyl-2-[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-7-yl]-6-hydroxyphenyl]-4-[[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-2-yl]oxy]-2-methoxybutanoate |
| SMILES (Canonical) | CC(=O)C1=C(C(=C(C=C1)O)C(CC(C(=O)OC)OC)OC2=C(C3=CC=CC=C3N2)CC4C(=O)NC(C(=O)N4)CC5=CC=CC=C5)C6=CC=CC7=C6NC=C7CC8C(=O)NC(C(=O)N8)CC9=CC=CC=C9 |
| SMILES (Isomeric) | CC(=O)C1=C(C(=C(C=C1)O)C(CC(C(=O)OC)OC)OC2=C(C3=CC=CC=C3N2)C[C@H]4C(=O)N[C@@H](C(=O)N4)CC5=CC=CC=C5)C6=CC=CC7=C6NC=C7C[C@H]8C(=O)N[C@@H](C(=O)N8)CC9=CC=CC=C9 |
| InChI | InChI=1S/C54H52N6O10/c1-29(61)33-21-22-43(62)47(46(33)36-19-12-18-34-32(28-55-48(34)36)25-41-51(65)56-39(49(63)58-41)23-30-13-6-4-7-14-30)44(27-45(68-2)54(67)69-3)70-53-37(35-17-10-11-20-38(35)60-53)26-42-52(66)57-40(50(64)59-42)24-31-15-8-5-9-16-31/h4-22,28,39-42,44-45,55,60,62H,23-27H2,1-3H3,(H,56,65)(H,57,66)(H,58,63)(H,59,64)/t39-,40-,41+,42+,44?,45?/m1/s1 |
| InChI Key | QDQRECYOOWEDRI-AXMUHOEVSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C54H52N6O10 |
| Molecular Weight | 945.00 g/mol |
| Exact Mass | 944.37449188 g/mol |
| Topological Polar Surface Area (TPSA) | 230.00 Ų |
| XlogP | 6.60 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.75% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.87% | 98.95% |
| CHEMBL240 | Q12809 | HERG | 98.49% | 89.76% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.35% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.75% | 85.14% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.63% | 98.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.37% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.21% | 94.45% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 94.20% | 92.62% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 93.68% | 95.50% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.40% | 99.15% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 91.66% | 95.56% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 90.94% | 83.10% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.26% | 99.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.86% | 90.08% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.61% | 93.03% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 88.95% | 97.64% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.13% | 88.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.96% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.95% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.36% | 89.00% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.10% | 91.19% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 83.41% | 92.67% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.26% | 91.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 83.01% | 94.75% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.93% | 95.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.90% | 95.89% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 82.65% | 96.39% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.45% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684304 |
| LOTUS | LTS0131379 |
| wikiData | Q105218931 |