Louisianin D
| Internal ID | 52cafda9-a7e9-416e-acb3-47f91945f374 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones > Aryl alkyl ketones |
| IUPAC Name | 4-[(E)-prop-1-enyl]-6,7-dihydrocyclopenta[c]pyridin-5-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H11NO/c1-2-3-8-6-12-7-9-4-5-10(13)11(8)9/h2-3,6-7H,4-5H2,1H3/b3-2+ |
| InChI Key | GPTPGVAFNHJJTP-NSCUHMNNSA-N |
| Popularity | 6 references in papers |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.084063974 g/mol |
| Topological Polar Surface Area (TPSA) | 30.00 Ų |
| XlogP | 1.60 |
| 4-[(E)-Prop-1-enyl]-6,7-dihydrocyclopenta[c]pyridin-5-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 93.18% | 85.30% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.31% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.79% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.65% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.42% | 99.23% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 85.18% | 92.51% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 84.20% | 89.63% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.47% | 93.31% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.43% | 89.34% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.79% | 93.40% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.50% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.40% | 96.09% |
| CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.30% | 98.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.78% | 94.75% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.58% | 81.29% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.56% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10130186 |
| LOTUS | LTS0081339 |
| wikiData | Q75067626 |