Lorneic acid G
| Internal ID | f9a1ed2d-09e5-46ea-9a95-030468ac2925 |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamyl alcohols |
| IUPAC Name | (E)-6-[2-[(E)-3-hydroxybut-1-enyl]-4-methylphenyl]hex-5-enoic acid |
| SMILES (Canonical) | CC1=CC(=C(C=C1)C=CCCCC(=O)O)C=CC(C)O |
| SMILES (Isomeric) | CC1=CC(=C(C=C1)/C=C/CCCC(=O)O)/C=C/C(C)O |
| InChI | InChI=1S/C17H22O3/c1-13-8-10-15(6-4-3-5-7-17(19)20)16(12-13)11-9-14(2)18/h4,6,8-12,14,18H,3,5,7H2,1-2H3,(H,19,20)/b6-4+,11-9+ |
| InChI Key | XKZQTPGPFAVCDK-HBWGMBCBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.15689456 g/mol |
| Topological Polar Surface Area (TPSA) | 57.50 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.08% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.82% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.08% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.67% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.21% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.76% | 94.73% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 89.82% | 91.49% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.27% | 93.56% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 86.44% | 97.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.09% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.07% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.91% | 86.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.15% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589806 |
| LOTUS | LTS0047378 |
| wikiData | Q105329799 |