Lophirachalcone
Internal ID | 2459ac10-9946-4fea-ad36-45cdb09b93dd |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (E)-3-[(2R)-3-[(R)-[5-[(2R,3S,4S,5S)-4-(2,4-dihydroxybenzoyl)-5-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methyl]oxolan-2-yl]-2,4-dihydroxyphenyl]-(2,4-dihydroxyphenyl)methyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=CC=C1CC2C(C(OC2C3=CC(=C(C=C3O)O)C(C4C(OC5=C4C=C(C=C5)C=CC(=O)C6=C(C=C(C=C6)O)O)C7=CC=C(C=C7)O)C8=C(C=C(C=C8)O)O)C9=CC=C(C=C9)O)C(=O)C1=C(C=C(C=C1)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C[C@H]2[C@@H]([C@H](O[C@H]2C3=CC(=C(C=C3O)O)[C@H](C4[C@@H](OC5=C4C=C(C=C5)/C=C/C(=O)C6=C(C=C(C=C6)O)O)C7=CC=C(C=C7)O)C8=C(C=C(C=C8)O)O)C9=CC=C(C=C9)O)C(=O)C1=C(C=C(C=C1)O)O)O |
InChI | InChI=1S/C60H48O15/c61-34-9-1-30(2-10-34)24-46-56(57(73)42-20-17-39(66)27-50(42)70)59(33-7-13-36(63)14-8-33)75-60(46)44-28-43(51(71)29-52(44)72)54(41-19-16-38(65)26-49(41)69)55-45-23-31(3-21-47(67)40-18-15-37(64)25-48(40)68)4-22-53(45)74-58(55)32-5-11-35(62)12-6-32/h1-23,25-29,46,54-56,58-66,68-72H,24H2/b21-3+/t46-,54+,55?,56+,58-,59+,60-/m0/s1 |
InChI Key | HUSLZNYNWSUNJK-GEIIHYOISA-N |
Popularity | 1 reference in papers |
Molecular Formula | C60H48O15 |
Molecular Weight | 1009.00 g/mol |
Exact Mass | 1008.29932082 g/mol |
Topological Polar Surface Area (TPSA) | 275.00 Ų |
XlogP | 10.20 |
122585-40-4 |
(E)-3-[(2R)-3-[(R)-[5-[(2R,3S,4S,5S)-4-(2,4-dihydroxybenzoyl)-5-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)methyl]oxolan-2-yl]-2,4-dihydroxyphenyl]-(2,4-dihydroxyphenyl)methyl]-2-(4-hydroxyphenyl)-2,3-dihydro-1-benzofuran-5-yl]-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
2-Propen-1-one, 3-(3-((5-(4-(2,4-dihydroxybenzoyl)tetrahydro-5-(4-hydroxyphenyl)-3-((4-hydroxyphenyl)methyl)-2-furanyl)-2,4-dihydroxyphenyl)(2,4-dihydroxyphenyl)methyl)-2-(4-hydroxyphenyl)-5-benzofuranyl)-1-(2,4-dihydroxyphenyl)-, (2alpha(R*(2R*,3R*,5(E))),3alpha,4beta,5alpha)-(+)- |
![2D Structure of Lophirachalcone 2D Structure of Lophirachalcone](https://plantaedb.com/storage/docs/compounds/2023/11/lophirachalcone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.78% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.75% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.42% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.82% | 94.45% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.14% | 95.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.31% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.12% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.32% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.79% | 91.49% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 90.12% | 97.64% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.25% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.99% | 99.17% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.61% | 95.50% |
CHEMBL3194 | P02766 | Transthyretin | 88.17% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.84% | 97.09% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 87.32% | 85.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.69% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.31% | 90.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.81% | 85.14% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.79% | 89.67% |
CHEMBL2535 | P11166 | Glucose transporter | 82.09% | 98.75% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.24% | 90.71% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.53% | 89.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.25% | 91.71% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.16% | 90.93% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.03% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lophira lanceolata |
PubChem | 16131338 |
LOTUS | LTS0191833 |
wikiData | Q104401120 |