Longibrachin LGB III
| Internal ID | 52dc3639-aa74-4279-8c0b-2972a96f2144 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (4S)-4-[[2-[[2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-2-[[2-[[2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[2-[[(2S)-2-[(2-acetamido-2-methylpropanoyl)amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]-2-methylbutanoyl]amino]-5-[[(2S)-5-amino-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)(C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(CC1=CC=CC=C1)C(=O)O)NC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C2CCCN2C(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | CCC(C)(C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC(=O)C(C)(C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)C(C)(C)NC(=O)[C@H](CC(C)C)NC(=O)CNC(=O)C(C)(C)NC(=O)[C@H](C(C)C)NC(=O)C(C)(C)NC(=O)[C@H](CCC(=O)N)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C91H148N22O26/c1-27-91(26,82(138)102-54(37-40-62(118)119)69(124)100-53(35-38-59(92)115)68(123)101-57(75(130)131)43-52-32-29-28-30-33-52)112-81(137)89(22,23)111-73(128)63(46(4)5)103-72(127)58-34-31-41-113(58)83(139)90(24,25)109-71(126)56(42-45(2)3)98-61(117)44-94-76(132)84(12,13)110-74(129)64(47(6)7)104-80(136)88(20,21)108-70(125)55(36-39-60(93)116)99-65(120)48(8)95-78(134)86(16,17)106-67(122)50(10)97-79(135)87(18,19)107-66(121)49(9)96-77(133)85(14,15)105-51(11)114/h28-30,32-33,45-50,53-58,63-64H,27,31,34-44H2,1-26H3,(H2,92,115)(H2,93,116)(H,94,132)(H,95,134)(H,96,133)(H,97,135)(H,98,117)(H,99,120)(H,100,124)(H,101,123)(H,102,138)(H,103,127)(H,104,136)(H,105,114)(H,106,122)(H,107,121)(H,108,125)(H,109,126)(H,110,129)(H,111,128)(H,112,137)(H,118,119)(H,130,131)/t48-,49-,50-,53-,54-,55-,56-,57-,58-,63-,64-,91?/m0/s1 |
| InChI Key | CZQWLPXGSNBACT-BYCSTOSASA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C91H148N22O26 |
| Molecular Weight | 1966.30 g/mol |
| Exact Mass | 1965.0935129 g/mol |
| Topological Polar Surface Area (TPSA) | 734.00 Ų |
| XlogP | -1.30 |
| Atomic LogP (AlogP) | -4.35 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 55 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7923 | 79.23% |
| Caco-2 | - | 0.8600 | 86.00% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Lysosomes | 0.5404 | 54.04% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8329 | 83.29% |
| OATP1B3 inhibitior | + | 0.9400 | 94.00% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | + | 0.9496 | 94.96% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8672 | 86.72% |
| CYP3A4 substrate | + | 0.7462 | 74.62% |
| CYP2C9 substrate | + | 0.6171 | 61.71% |
| CYP2D6 substrate | - | 0.8589 | 85.89% |
| CYP3A4 inhibition | + | 0.5000 | 50.00% |
| CYP2C9 inhibition | - | 0.8608 | 86.08% |
| CYP2C19 inhibition | - | 0.6565 | 65.65% |
| CYP2D6 inhibition | - | 0.8928 | 89.28% |
| CYP1A2 inhibition | - | 0.8909 | 89.09% |
| CYP2C8 inhibition | + | 0.7344 | 73.44% |
| CYP inhibitory promiscuity | - | 0.9360 | 93.60% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8200 | 82.00% |
| Carcinogenicity (trinary) | Non-required | 0.6389 | 63.89% |
| Eye corrosion | - | 0.9901 | 99.01% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7983 | 79.83% |
| Skin corrosion | - | 0.9190 | 91.90% |
| Ames mutagenesis | - | 0.7578 | 75.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7070 | 70.70% |
| Micronuclear | + | 0.6800 | 68.00% |
| Hepatotoxicity | + | 0.6750 | 67.50% |
| skin sensitisation | - | 0.8877 | 88.77% |
| Respiratory toxicity | + | 0.8444 | 84.44% |
| Reproductive toxicity | + | 0.9000 | 90.00% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.9059 | 90.59% |
| Acute Oral Toxicity (c) | III | 0.6272 | 62.72% |
| Estrogen receptor binding | - | 0.6027 | 60.27% |
| Androgen receptor binding | + | 0.7590 | 75.90% |
| Thyroid receptor binding | + | 0.7847 | 78.47% |
| Glucocorticoid receptor binding | + | 0.8392 | 83.92% |
| Aromatase binding | + | 0.8176 | 81.76% |
| PPAR gamma | + | 0.7991 | 79.91% |
| Honey bee toxicity | - | 0.7306 | 73.06% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
| Fish aquatic toxicity | + | 0.8879 | 88.79% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.98% | 98.95% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 99.59% | 94.45% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.05% | 98.33% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.82% | 96.61% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.65% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.50% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.86% | 96.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 97.79% | 95.17% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 97.30% | 98.24% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 96.31% | 95.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 96.08% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 95.88% | 97.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.95% | 91.11% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.95% | 98.94% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.65% | 97.64% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 94.01% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 93.92% | 93.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 93.05% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.61% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.18% | 99.17% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.60% | 82.69% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.51% | 91.19% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.23% | 96.47% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 90.86% | 96.03% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.77% | 89.63% |
| CHEMBL236 | P41143 | Delta opioid receptor | 90.58% | 99.35% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 90.31% | 93.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 90.13% | 92.80% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.05% | 97.23% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.01% | 95.38% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.71% | 96.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.19% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.83% | 95.56% |
| CHEMBL4801 | P29466 | Caspase-1 | 85.22% | 96.85% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 85.04% | 83.14% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 84.79% | 96.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.74% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.54% | 94.45% |
| CHEMBL4625 | Q07817 | Apoptosis regulator Bcl-X | 83.83% | 99.77% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 83.82% | 82.38% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.79% | 96.67% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 83.74% | 96.67% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 83.65% | 88.42% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.40% | 90.71% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 83.37% | 81.29% |
| CHEMBL5028 | O14672 | ADAM10 | 83.14% | 97.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.75% | 95.89% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 82.11% | 90.65% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.25% | 89.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.01% | 95.00% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.91% | 97.50% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.85% | 97.50% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 80.75% | 82.50% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.74% | 83.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588765 |
| LOTUS | LTS0159686 |
| wikiData | Q104973040 |