Longibrachin LGB II
| Internal ID | add99899-b874-418a-b865-968ae4eea108 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides |
| IUPAC Name | (4S)-4-[[2-[[2-[[(2S)-2-[[(2S)-1-[2-[[(2S)-2-[[2-[[2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-[[2-[[(2S)-2-[(2-acetamido-2-methylpropanoyl)amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-2-methylpropanoyl]amino]propanoyl]amino]-5-amino-5-oxopentanoyl]amino]-2-methylpropanoyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-2-methylpropanoyl]pyrrolidine-2-carbonyl]amino]-3-methylbutanoyl]amino]-2-methylpropanoyl]amino]-2-methylpropanoyl]amino]-5-[[(2S)-5-amino-1-[[(1S)-1-carboxy-2-phenylethyl]amino]-1,5-dioxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=CC=C2)C(=O)O)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(C)(C)NC(=O)C |
| SMILES (Isomeric) | C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)NC(C)(C)C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)NC(C)(C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)[C@H](C)NC(=O)C(C)(C)NC(=O)C |
| InChI | InChI=1S/C90H146N22O26/c1-44(2)41-55(70(125)108-90(25,26)82(138)112-40-30-33-57(112)71(126)102-62(45(3)4)72(127)110-89(23,24)81(137)111-88(21,22)79(135)101-53(36-39-61(117)118)68(123)99-52(34-37-58(91)114)67(122)100-56(74(129)130)42-51-31-28-27-29-32-51)97-60(116)43-93-75(131)83(11,12)109-73(128)63(46(5)6)103-80(136)87(19,20)107-69(124)54(35-38-59(92)115)98-64(119)47(7)94-77(133)85(15,16)105-66(121)49(9)96-78(134)86(17,18)106-65(120)48(8)95-76(132)84(13,14)104-50(10)113/h27-29,31-32,44-49,52-57,62-63H,30,33-43H2,1-26H3,(H2,91,114)(H2,92,115)(H,93,131)(H,94,133)(H,95,132)(H,96,134)(H,97,116)(H,98,119)(H,99,123)(H,100,122)(H,101,135)(H,102,126)(H,103,136)(H,104,113)(H,105,121)(H,106,120)(H,107,124)(H,108,125)(H,109,128)(H,110,127)(H,111,137)(H,117,118)(H,129,130)/t47-,48-,49-,52-,53-,54-,55-,56-,57-,62-,63-/m0/s1 |
| InChI Key | PKHJDBCKUHACEM-DYSRVMAUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C90H146N22O26 |
| Molecular Weight | 1952.30 g/mol |
| Exact Mass | 1951.0778629 g/mol |
| Topological Polar Surface Area (TPSA) | 734.00 Ų |
| XlogP | -1.90 |
| Atomic LogP (AlogP) | -4.74 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 23 |
| Rotatable Bonds | 54 |
| RefChem:154005 |
| 161726-96-1 |
| (4S)-4-((2-((2-(((2S)-2-(((2S)-1-(2-(((2S)-2-((2-((2-(((2S)-2-((2-(((2S)-2-(((2S)-2-((2-(((2S)-2-((2-(((2S)-2-((2-acetamido-2-methylpropanoyl)amino)propanoyl)amino)-2-methylpropanoyl)amino)propanoyl)amino)-2-methylpropanoyl)amino)propanoyl)amino)-5-amino-5-oxopentanoyl)amino)-2-methylpropanoyl)amino)-3-methylbutanoyl)amino)-2-methylpropanoyl)amino)acetyl)amino)-4-methylpentanoyl)amino)-2-methylpropanoyl)pyrrolidine-2-carbonyl)amino)-3-methylbutanoyl)amino)-2-methylpropanoyl)amino)-2-methylpropanoyl)amino)-5-(((2S)-5-amino-1-(((1S)-1-carboxy-2-phenylethyl)amino)-1,5-dioxopentan-2-yl)amino)-5-oxopentanoic acid |
| (4S)-5-((2S)-1-((1S)-1-carboxy-2-phenylethyl)imino-1,5-dihydroxy-5-iminopentan-2-yl)imino-4-((2-((2-(((2S)-2-((((2S)-1-(2-(((2S)-2-((2-((2-(((2S)-2-((2-(((2S)-1,5-dihydroxy-2-(((2S)-1-hydroxy-2-((1-hydroxy-2-(((2S)-1-hydroxy-2-((1-hydroxy-2-(((2S)-1-hydroxy-2-((1-hydroxy-2-(1-hydroxyethylideneamino)-2-methylpropylidene)amino)propylidene)amino)-2-methylpropylidene)amino)propylidene)amino)-2-methylpropylidene)amino)propylidene)amino)-5-iminopentylidene)amino)-1-hydroxy-2-methylpropylidene)amino)-1-hydroxy-3-methylbutylidene)amino)-1-hydroxy-2-methylpropylidene)amino)-1-hydroxyethylidene)amino)-1-hydroxy-4-methylpentylidene)amino)-2-methylpropanoyl)pyrrolidin-2-yl)-hydroxymethylidene)amino)-1-hydroxy-3-methylbutylidene)amino)-1-hydroxy-2-methylpropylidene)amino)-1-hydroxy-2-methylpropylidene)amino)-5-hydroxypentanoic acid |
| CHEBI:219390 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6403 | 64.03% |
| Caco-2 | - | 0.8604 | 86.04% |
| Blood Brain Barrier | - | 0.7250 | 72.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Lysosomes | 0.5204 | 52.04% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8429 | 84.29% |
| OATP1B3 inhibitior | + | 0.9424 | 94.24% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9500 | 95.00% |
| BSEP inhibitior | + | 0.9538 | 95.38% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8699 | 86.99% |
| CYP3A4 substrate | + | 0.7430 | 74.30% |
| CYP2C9 substrate | + | 0.6171 | 61.71% |
| CYP2D6 substrate | - | 0.8589 | 85.89% |
| CYP3A4 inhibition | - | 0.6273 | 62.73% |
| CYP2C9 inhibition | - | 0.8792 | 87.92% |
| CYP2C19 inhibition | - | 0.6328 | 63.28% |
| CYP2D6 inhibition | - | 0.9061 | 90.61% |
| CYP1A2 inhibition | - | 0.9019 | 90.19% |
| CYP2C8 inhibition | + | 0.6893 | 68.93% |
| CYP inhibitory promiscuity | - | 0.9487 | 94.87% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.8500 | 85.00% |
| Carcinogenicity (trinary) | Non-required | 0.6358 | 63.58% |
| Eye corrosion | - | 0.9903 | 99.03% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7932 | 79.32% |
| Skin corrosion | - | 0.9202 | 92.02% |
| Ames mutagenesis | - | 0.7678 | 76.78% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7116 | 71.16% |
| Micronuclear | + | 0.6700 | 67.00% |
| Hepatotoxicity | + | 0.6500 | 65.00% |
| skin sensitisation | - | 0.8892 | 88.92% |
| Respiratory toxicity | + | 0.8556 | 85.56% |
| Reproductive toxicity | + | 0.9111 | 91.11% |
| Mitochondrial toxicity | + | 0.9125 | 91.25% |
| Nephrotoxicity | - | 0.8819 | 88.19% |
| Acute Oral Toxicity (c) | III | 0.6397 | 63.97% |
| Estrogen receptor binding | - | 0.5832 | 58.32% |
| Androgen receptor binding | + | 0.7542 | 75.42% |
| Thyroid receptor binding | + | 0.7879 | 78.79% |
| Glucocorticoid receptor binding | + | 0.8437 | 84.37% |
| Aromatase binding | + | 0.8153 | 81.53% |
| PPAR gamma | + | 0.7964 | 79.64% |
| Honey bee toxicity | - | 0.7501 | 75.01% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | + | 0.5300 | 53.00% |
| Fish aquatic toxicity | + | 0.8446 | 84.46% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.98% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.40% | 96.61% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 99.02% | 98.33% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 98.66% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.62% | 90.17% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.21% | 95.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.00% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.67% | 96.09% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 96.89% | 98.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.40% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 95.65% | 100.00% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 95.38% | 97.14% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 94.91% | 95.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 94.43% | 98.94% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 94.11% | 93.00% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.02% | 97.64% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.61% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 93.22% | 96.03% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 92.60% | 82.69% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 92.27% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.06% | 97.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.80% | 89.63% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.78% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.68% | 91.19% |
| CHEMBL1873 | P00750 | Tissue-type plasminogen activator | 91.49% | 93.33% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 91.00% | 92.80% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 90.32% | 97.23% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 90.21% | 95.38% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.95% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.89% | 96.00% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 88.78% | 88.42% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 87.79% | 81.29% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.60% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.67% | 95.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 86.42% | 99.35% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 85.44% | 96.67% |
| CHEMBL5028 | O14672 | ADAM10 | 85.17% | 97.50% |
| CHEMBL4123 | P30989 | Neurotensin receptor 1 | 85.10% | 96.67% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.76% | 98.75% |
| CHEMBL4801 | P29466 | Caspase-1 | 84.71% | 96.85% |
| CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 84.40% | 83.14% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.19% | 94.45% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 84.18% | 83.10% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 84.12% | 96.67% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 83.79% | 82.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.44% | 90.71% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.41% | 95.89% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.97% | 97.21% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 82.64% | 82.38% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 81.89% | 89.33% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 81.41% | 90.65% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.06% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139588764 |
| LOTUS | LTS0081631 |
| wikiData | Q105210420 |