Longiborneol
| Internal ID | c6323643-761c-404c-8a5e-3fdaf64876c1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | 2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-8-ol |
| SMILES (Canonical) | CC1(CCCC2(C3C1C(C2(CC3)C)O)C)C |
| SMILES (Isomeric) | CC1(CCCC2(C3C1C(C2(CC3)C)O)C)C |
| InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)10-6-9-15(14,4)12(16)11(10)13/h10-12,16H,5-9H2,1-4H3 |
| InChI Key | MNNFKQAYXGEKFA-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.198365449 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 4.50 |
| decahydro-1,5,5,8a-tetramethyl-1,4-methanoazulen-9-ol |
| 465-24-7 |
| MNNFKQAYXGEKFA-UHFFFAOYSA-N |
| 2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-8-ol |
| 1,4-Methanoazulen-9-ol, decahydro-1,5,5,8a-tetramethyl-, [1R-(1.alpha. .. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.83% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.65% | 96.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.44% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.10% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.33% | 92.94% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.89% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.49% | 95.89% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.99% | 82.69% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.65% | 95.50% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.18% | 96.43% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.00% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia argyi |
| Cedrus libani |
| Chiloscyphus pallescens |
| Cupressus macrocarpa |
| Pinus densiflora |
| PubChem | 521200 |
| LOTUS | LTS0025924 |
| wikiData | Q105168479 |