Locillomycin C
Internal ID | 0d64de4c-f1fb-4f02-b8b0-19d01e4664c4 |
Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
IUPAC Name | 2-[(3S,6S,12S,15S,21S,24R,27S)-15-(2-amino-2-oxoethyl)-24-(3-amino-3-oxopropyl)-12-(carboxymethyl)-6-[(4-hydroxyphenyl)methyl]-28-methyl-2,5,8,11,14,17,20,23,26-nonaoxo-27-(pentadecanoylamino)-3-propan-2-yl-1-oxa-4,7,10,13,16,19,22,25-octazacyclooctacos-21-yl]acetic acid |
SMILES (Canonical) | CCCCCCCCCCCCCCC(=O)NC1C(OC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC1=O)CCC(=O)N)CC(=O)O)CC(=O)N)CC(=O)O)CC2=CC=C(C=C2)O)C(C)C)C |
SMILES (Isomeric) | CCCCCCCCCCCCCCC(=O)N[C@H]1C(OC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)[C@H](NC1=O)CCC(=O)N)CC(=O)O)CC(=O)N)CC(=O)O)CC2=CC=C(C=C2)O)C(C)C)C |
InChI | InChI=1S/C54H83N11O18/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-41(69)64-47-31(4)83-54(82)46(30(2)3)65-52(80)35(24-32-18-20-33(66)21-19-32)59-42(70)28-57-49(77)38(27-45(74)75)63-51(79)36(25-40(56)68)60-43(71)29-58-48(76)37(26-44(72)73)62-50(78)34(61-53(47)81)22-23-39(55)67/h18-21,30-31,34-38,46-47,66H,5-17,22-29H2,1-4H3,(H2,55,67)(H2,56,68)(H,57,77)(H,58,76)(H,59,70)(H,60,71)(H,61,81)(H,62,78)(H,63,79)(H,64,69)(H,65,80)(H,72,73)(H,74,75)/t31?,34-,35+,36+,37+,38+,46+,47+/m1/s1 |
InChI Key | RTROBJGJIRFPPO-FICQDJQNSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H83N11O18 |
Molecular Weight | 1174.30 g/mol |
Exact Mass | 1173.59175484 g/mol |
Topological Polar Surface Area (TPSA) | 469.00 Ų |
XlogP | 1.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.48% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.25% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.20% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.22% | 93.10% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.04% | 94.45% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.55% | 90.08% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 89.16% | 100.00% |
CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 89.02% | 95.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.47% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.26% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.49% | 95.56% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.46% | 93.00% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 86.56% | 97.64% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 85.99% | 96.90% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.90% | 96.47% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.19% | 97.25% |
CHEMBL4071 | P08311 | Cathepsin G | 85.10% | 94.64% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.01% | 90.71% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.45% | 83.82% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.23% | 94.73% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.21% | 91.38% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 84.09% | 97.79% |
CHEMBL236 | P41143 | Delta opioid receptor | 84.06% | 99.35% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.02% | 98.59% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.19% | 100.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.98% | 95.89% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.52% | 95.50% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.46% | 85.00% |
CHEMBL3891 | P07384 | Calpain 1 | 80.29% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper nigrum |
PubChem | 145720664 |
LOTUS | LTS0248983 |
wikiData | Q105140014 |