Litsealactone B
Internal ID | dd33e17c-03bb-4693-ac17-c1d62b07db3a |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | (3R,4S,5S)-3-[(E)-dodec-1-en-11-ynyl]-4-hydroxy-5-methyloxolan-2-one |
SMILES (Canonical) | CC1C(C(C(=O)O1)C=CCCCCCCCCC#C)O |
SMILES (Isomeric) | C[C@H]1[C@H]([C@H](C(=O)O1)/C=C/CCCCCCCCC#C)O |
InChI | InChI=1S/C17H26O3/c1-3-4-5-6-7-8-9-10-11-12-13-15-16(18)14(2)20-17(15)19/h1,12-16,18H,4-11H2,2H3/b13-12+/t14-,15+,16+/m0/s1 |
InChI Key | PXTVBTOIMPMCRQ-JDCHRCQMSA-N |
Popularity | 2 references in papers |
Molecular Formula | C17H26O3 |
Molecular Weight | 278.40 g/mol |
Exact Mass | 278.18819469 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 4.40 |
CHEMBL461617 |
SCHEMBL17651641 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.46% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.75% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 90.17% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 88.06% | 91.49% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.46% | 89.34% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.89% | 89.63% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.27% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.80% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.03% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.99% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.93% | 96.00% |
CHEMBL1829 | O15379 | Histone deacetylase 3 | 82.73% | 95.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.00% | 90.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.54% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Litsea japonica |
PubChem | 11219681 |
LOTUS | LTS0086724 |
wikiData | Q105216387 |