Lipoxazolidinone C
| Internal ID | 29d5d6e4-0fe0-4791-a27e-cb0f4cb62153 |
| Taxonomy | Organoheterocyclic compounds > Azolidines > Oxazolidines > Oxazolidinones |
| IUPAC Name | (2E)-5-butyl-2-[(E)-4-methyl-2-oxodec-3-enylidene]-1,3-oxazolidin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H29NO3/c1-4-6-8-9-10-14(3)12-15(20)13-17-19-18(21)16(22-17)11-7-5-2/h12-13,16H,4-11H2,1-3H3,(H,19,21)/b14-12+,17-13+ |
| InChI Key | NHCONVHYGAHXRU-SWZGKVDCSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.21474379 g/mol |
| Topological Polar Surface Area (TPSA) | 55.40 Ų |
| XlogP | 5.20 |
| lipoxazolidine C |
| CHEMBL251478 |
| SCHEMBL12812711 |
| (2E)-5-butyl-2-[(E)-4-methyl-2-oxodec-3-enylidene]-1,3-oxazolidin-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.94% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.37% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 93.14% | 89.63% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.28% | 98.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 91.86% | 98.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.37% | 97.25% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 88.36% | 92.08% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.14% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.54% | 98.59% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.63% | 100.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.32% | 97.79% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.77% | 97.29% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.21% | 95.92% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.46% | 90.08% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.85% | 89.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.50% | 92.88% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.48% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.29% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 23642823 |
| LOTUS | LTS0222332 |
| wikiData | Q77493030 |