Linoleic acid propyl ester
| Internal ID | 0ad03915-df68-425f-8cd6-10a8c918b568 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Lineolic acids and derivatives |
| IUPAC Name | propyl (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES (Canonical) | CCCCCC=CCC=CCCCCCCCC(=O)OCCC |
| SMILES (Isomeric) | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCCC |
| InChI | InChI=1S/C21H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20-4-2/h8-9,11-12H,3-7,10,13-20H2,1-2H3/b9-8-,12-11- |
| InChI Key | AJAMRCUNWLZBDF-MURFETPASA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.287180451 g/mol |
| Topological Polar Surface Area (TPSA) | 26.30 Ų |
| XlogP | 7.80 |
| Atomic LogP (AlogP) | 6.75 |
| H-Bond Acceptor | 2 |
| H-Bond Donor | 0 |
| Rotatable Bonds | 16 |
| 38433-95-3 |
| n-propyl linoleate |
| propyl linoleate |
| Propyl (9Z,12Z)-octadeca-9,12-dienoate |
| (9Z,12Z)-Propyl octadeca-9,12-dienoate |
| n-Propyl 9,12-octadecadienoate |
| SCHEMBL423106 |
| CHEBI:91035 |
| AJAMRCUNWLZBDF-MURFETPASA-N |
| propyl (9Z,12Z)-octadecadienoate |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9973 | 99.73% |
| Caco-2 | + | 0.7565 | 75.65% |
| Blood Brain Barrier | + | 0.9250 | 92.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Plasma membrane | 0.4591 | 45.91% |
| OATP2B1 inhibitior | - | 0.8506 | 85.06% |
| OATP1B1 inhibitior | - | 0.3462 | 34.62% |
| OATP1B3 inhibitior | + | 0.8915 | 89.15% |
| MATE1 inhibitior | - | 0.9000 | 90.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.7192 | 71.92% |
| P-glycoprotein inhibitior | - | 0.6257 | 62.57% |
| P-glycoprotein substrate | - | 0.9220 | 92.20% |
| CYP3A4 substrate | - | 0.5299 | 52.99% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8696 | 86.96% |
| CYP3A4 inhibition | - | 0.9367 | 93.67% |
| CYP2C9 inhibition | - | 0.9404 | 94.04% |
| CYP2C19 inhibition | - | 0.9332 | 93.32% |
| CYP2D6 inhibition | - | 0.9270 | 92.70% |
| CYP1A2 inhibition | + | 0.5902 | 59.02% |
| CYP2C8 inhibition | - | 0.6558 | 65.58% |
| CYP inhibitory promiscuity | - | 0.7514 | 75.14% |
| UGT catelyzed | - | 0.0000 | 0.00% |
| Carcinogenicity (binary) | - | 0.6400 | 64.00% |
| Carcinogenicity (trinary) | Non-required | 0.6571 | 65.71% |
| Eye corrosion | + | 0.9617 | 96.17% |
| Eye irritation | + | 0.7341 | 73.41% |
| Skin irritation | + | 0.6057 | 60.57% |
| Skin corrosion | - | 0.9939 | 99.39% |
| Ames mutagenesis | - | 0.8800 | 88.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3654 | 36.54% |
| Micronuclear | - | 1.0000 | 100.00% |
| Hepatotoxicity | - | 0.5289 | 52.89% |
| skin sensitisation | + | 0.8576 | 85.76% |
| Respiratory toxicity | - | 0.8222 | 82.22% |
| Reproductive toxicity | - | 1.0000 | 100.00% |
| Mitochondrial toxicity | - | 1.0000 | 100.00% |
| Nephrotoxicity | - | 0.6215 | 62.15% |
| Acute Oral Toxicity (c) | III | 0.8627 | 86.27% |
| Estrogen receptor binding | - | 0.5000 | 50.00% |
| Androgen receptor binding | - | 0.8156 | 81.56% |
| Thyroid receptor binding | - | 0.5660 | 56.60% |
| Glucocorticoid receptor binding | - | 0.5784 | 57.84% |
| Aromatase binding | - | 0.7674 | 76.74% |
| PPAR gamma | + | 0.6109 | 61.09% |
| Honey bee toxicity | - | 0.9860 | 98.60% |
| Biodegradation | + | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | + | 0.8678 | 86.78% |
| Fish aquatic toxicity | + | 0.9786 | 97.86% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.44% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.03% | 96.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.99% | 92.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.01% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.71% | 89.63% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 92.38% | 85.94% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.06% | 97.29% |
| CHEMBL239 | Q07869 | Peroxisome proliferator-activated receptor alpha | 87.51% | 90.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.56% | 90.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 85.02% | 97.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.65% | 91.81% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.41% | 86.33% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 82.57% | 94.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.47% | 91.11% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.44% | 92.50% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 81.26% | 89.34% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.11% | 96.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.39% | 96.95% |
| PubChem | 9949088 |
| LOTUS | LTS0162982 |
| wikiData | Q27163033 |