Linderadin
Internal ID | 8b6d3afc-a129-4f6b-9fb6-2eb104e72d57 |
Taxonomy | Organoheterocyclic compounds > Dioxanes > 1,4-dioxanes |
IUPAC Name | (1S,4R,6S,13S,14R)-6,11-dimethyl-5,9,15,17-tetraoxapentacyclo[11.2.2.01,14.04,6.08,12]heptadeca-8(12),10-dien-16-one |
SMILES (Canonical) | CC1=COC2=C1C3C4C(O4)(CCC5C(C2)(O5)C)C(=O)O3 |
SMILES (Isomeric) | CC1=COC2=C1[C@H]3[C@@H]4[C@@](O4)(CC[C@@H]5[C@](C2)(O5)C)C(=O)O3 |
InChI | InChI=1S/C15H16O5/c1-7-6-17-8-5-14(2)9(19-14)3-4-15-12(20-15)11(10(7)8)18-13(15)16/h6,9,11-12H,3-5H2,1-2H3/t9-,11+,12-,14+,15+/m1/s1 |
InChI Key | XADIBULSXQTZTI-OGGHUHLFSA-N |
Popularity | 3 references in papers |
Molecular Formula | C15H16O5 |
Molecular Weight | 276.28 g/mol |
Exact Mass | 276.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 64.50 Ų |
XlogP | 1.20 |
CHEBI:69076 |
Q27137416 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.08% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.46% | 97.09% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.33% | 93.04% |
CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 87.19% | 95.34% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.91% | 89.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.74% | 97.14% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.70% | 99.23% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 85.36% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.93% | 97.25% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 84.40% | 96.25% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.51% | 90.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.55% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.36% | 91.11% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.23% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Neolitsea hiiranensis |
Neolitsea villosa |
PubChem | 70698069 |
LOTUS | LTS0111067 |
wikiData | Q27137416 |