Lincomycin A
| Internal ID | a6c1e5a6-7c85-4c50-84da-d7077c4f916f |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Proline and derivatives |
| IUPAC Name | (2S,4R)-N-[(1S)-2-hydroxy-1-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide |
| SMILES (Canonical) | CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)O)O)O)C(C)O |
| SMILES (Isomeric) | CCC[C@@H]1C[C@H](N(C1)C)C(=O)N[C@H](C2[C@@H]([C@@H]([C@H]([C@H](O2)SC)O)O)O)C(C)O |
| InChI | InChI=1S/C18H34N2O6S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25)/t9?,10-,11+,12+,13+,14-,15-,16?,18-/m1/s1 |
| InChI Key | OJMMVQQUTAEWLP-ZUWRKQLMSA-N |
| Popularity | 2,204 references in papers |
| Molecular Formula | C18H34N2O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21375798 g/mol |
| Topological Polar Surface Area (TPSA) | 148.00 Ų |
| XlogP | 0.20 |
| Atomic LogP (AlogP) | -0.86 |
| H-Bond Acceptor | 8 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 7 |
| 12768-69-3 |
| DTXSID50925936 |
| OJMMVQQUTAEWLP-ZUWRKQLMSA-N |
| Methyl 6,8-dideoxy-6-{[hydroxy(1-methyl-4-propylpyrrolidin-2-yl)methylidene]amino}-1-thiooctopyranoside |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.9658 | 96.58% |
| Caco-2 | - | 0.7523 | 75.23% |
| Blood Brain Barrier | - | 0.9750 | 97.50% |
| Human oral bioavailability | - | 0.8429 | 84.29% |
| Subcellular localzation | Lysosomes | 0.5026 | 50.26% |
| OATP2B1 inhibitior | - | 0.8570 | 85.70% |
| OATP1B1 inhibitior | + | 0.9393 | 93.93% |
| OATP1B3 inhibitior | + | 0.9289 | 92.89% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9750 | 97.50% |
| BSEP inhibitior | - | 0.8621 | 86.21% |
| P-glycoprotein inhibitior | - | 0.8547 | 85.47% |
| P-glycoprotein substrate | + | 0.9344 | 93.44% |
| CYP3A4 substrate | + | 0.7160 | 71.60% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.7952 | 79.52% |
| CYP3A4 inhibition | - | 0.9342 | 93.42% |
| CYP2C9 inhibition | - | 0.9070 | 90.70% |
| CYP2C19 inhibition | - | 0.9203 | 92.03% |
| CYP2D6 inhibition | - | 0.9269 | 92.69% |
| CYP1A2 inhibition | - | 0.9222 | 92.22% |
| CYP2C8 inhibition | - | 0.9844 | 98.44% |
| CYP inhibitory promiscuity | - | 0.9563 | 95.63% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.6495 | 64.95% |
| Eye corrosion | - | 0.9888 | 98.88% |
| Eye irritation | - | 0.9902 | 99.02% |
| Skin irritation | - | 0.7575 | 75.75% |
| Skin corrosion | - | 0.9137 | 91.37% |
| Ames mutagenesis | - | 0.7337 | 73.37% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.7971 | 79.71% |
| Micronuclear | + | 0.7400 | 74.00% |
| Hepatotoxicity | + | 0.7375 | 73.75% |
| skin sensitisation | - | 0.8580 | 85.80% |
| Respiratory toxicity | + | 0.9444 | 94.44% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 1.0000 | 100.00% |
| Nephrotoxicity | + | 0.6324 | 63.24% |
| Acute Oral Toxicity (c) | III | 0.7675 | 76.75% |
| Estrogen receptor binding | - | 0.5000 | 50.00% |
| Androgen receptor binding | - | 0.8512 | 85.12% |
| Thyroid receptor binding | + | 0.5669 | 56.69% |
| Glucocorticoid receptor binding | - | 0.8661 | 86.61% |
| Aromatase binding | + | 0.5519 | 55.19% |
| PPAR gamma | - | 0.6326 | 63.26% |
| Honey bee toxicity | - | 0.7634 | 76.34% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.8700 | 87.00% |
| Fish aquatic toxicity | - | 0.4904 | 49.04% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
63.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.59% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.23% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.87% | 90.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.24% | 97.21% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.05% | 95.58% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 93.51% | 92.12% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.20% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.49% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.42% | 90.71% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.39% | 94.66% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 91.05% | 94.50% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.70% | 89.63% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.50% | 95.17% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 90.44% | 97.50% |
| CHEMBL240 | Q12809 | HERG | 89.97% | 89.76% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 89.90% | 94.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.77% | 95.71% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.54% | 92.86% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.32% | 92.29% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.01% | 83.82% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.52% | 96.95% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.48% | 98.05% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.44% | 96.47% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 88.22% | 97.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.61% | 97.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.56% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 87.47% | 98.46% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.31% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.08% | 100.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 86.67% | 98.77% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.55% | 89.50% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.95% | 89.34% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.88% | 96.61% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.86% | 90.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.28% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.12% | 98.59% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.12% | 96.38% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.10% | 99.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.07% | 92.50% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.98% | 96.31% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 82.38% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.29% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.95% | 91.19% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 80.55% | 97.29% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.02% | 96.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9063 |
| LOTUS | LTS0045375 |
| wikiData | Q82900370 |