Linaclotide
| Internal ID | 1ebe4055-0ac3-48d5-989b-a067d4607297 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | (2S)-2-[[(1R,4S,7S,13S,16R,21R,24R,27S,30S,33R,38R,44S)-21-amino-13-(2-amino-2-oxoethyl)-27-(2-carboxyethyl)-44-[(1R)-1-hydroxyethyl]-30-[(4-hydroxyphenyl)methyl]-4-methyl-3,6,12,15,22,25,28,31,40,43,46,51-dodecaoxo-18,19,35,36,48,49-hexathia-2,5,11,14,23,26,29,32,39,42,45,52-dodecazatetracyclo[22.22.4.216,33.07,11]dopentacontane-38-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC1C(=O)NC2CSSCC3C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(NC(=O)CNC(=O)C(NC2=O)C(C)O)C(=O)NC(CC4=CC=C(C=C4)O)C(=O)O)C(=O)NC(CSSCC(C(=O)N3)N)C(=O)NC(C(=O)N5CCCC5C(=O)N1)CC(=O)N)CC6=CC=C(C=C6)O)CCC(=O)O |
| SMILES (Isomeric) | C[C@H]1C(=O)N[C@H]2CSSC[C@H]3C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@H](NC(=O)CNC(=O)[C@@H](NC2=O)[C@@H](C)O)C(=O)N[C@@H](CC4=CC=C(C=C4)O)C(=O)O)C(=O)N[C@@H](CSSC[C@@H](C(=O)N3)N)C(=O)N[C@H](C(=O)N5CCC[C@H]5C(=O)N1)CC(=O)N)CC6=CC=C(C=C6)O)CCC(=O)O |
| InChI | InChI=1S/C59H79N15O21S6/c1-26-47(82)69-41-25-101-99-22-38-52(87)65-33(13-14-45(80)81)49(84)66-34(16-28-5-9-30(76)10-6-28)50(85)71-40(54(89)72-39(23-97-96-20-32(60)48(83)70-38)53(88)67-35(18-43(61)78)58(93)74-15-3-4-42(74)56(91)63-26)24-100-98-21-37(64-44(79)19-62-57(92)46(27(2)75)73-55(41)90)51(86)68-36(59(94)95)17-29-7-11-31(77)12-8-29/h5-12,26-27,32-42,46,75-77H,3-4,13-25,60H2,1-2H3,(H2,61,78)(H,62,92)(H,63,91)(H,64,79)(H,65,87)(H,66,84)(H,67,88)(H,68,86)(H,69,82)(H,70,83)(H,71,85)(H,72,89)(H,73,90)(H,80,81)(H,94,95)/t26-,27+,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,46-/m0/s1 |
| InChI Key | KXGCNMMJRFDFNR-WDRJZQOASA-N |
| Popularity | 557 references in papers |
| Molecular Formula | C59H79N15O21S6 |
| Molecular Weight | 1526.80 g/mol |
| Exact Mass | 1525.3899216 g/mol |
| Topological Polar Surface Area (TPSA) | 726.00 Ų |
| XlogP | -6.80 |
| Atomic LogP (AlogP) | -5.94 |
| H-Bond Acceptor | 26 |
| H-Bond Donor | 19 |
| Rotatable Bonds | 13 |
| Linzess |
| 851199-59-2 |
| Constella |
| UNII-N0TXR0XR5X |
| HSDB 8224 |
| Linaclotide [USAN:INN] |
| N0TXR0XR5X |
| ASP 0456 |
| CHEBI:68551 |
| ASP0456 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5166 | 51.66% |
| Caco-2 | - | 0.8618 | 86.18% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.5215 | 52.15% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8314 | 83.14% |
| OATP1B3 inhibitior | + | 0.9350 | 93.50% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8750 | 87.50% |
| BSEP inhibitior | + | 0.9498 | 94.98% |
| P-glycoprotein inhibitior | + | 0.7425 | 74.25% |
| P-glycoprotein substrate | + | 0.8910 | 89.10% |
| CYP3A4 substrate | + | 0.7378 | 73.78% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8054 | 80.54% |
| CYP3A4 inhibition | - | 0.8592 | 85.92% |
| CYP2C9 inhibition | - | 0.8507 | 85.07% |
| CYP2C19 inhibition | - | 0.8164 | 81.64% |
| CYP2D6 inhibition | - | 0.8759 | 87.59% |
| CYP1A2 inhibition | - | 0.9053 | 90.53% |
| CYP2C8 inhibition | + | 0.7877 | 78.77% |
| CYP inhibitory promiscuity | - | 0.8908 | 89.08% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7900 | 79.00% |
| Carcinogenicity (trinary) | Non-required | 0.6011 | 60.11% |
| Eye corrosion | - | 0.9868 | 98.68% |
| Eye irritation | - | 0.8964 | 89.64% |
| Skin irritation | - | 0.7706 | 77.06% |
| Skin corrosion | - | 0.9293 | 92.93% |
| Ames mutagenesis | - | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6544 | 65.44% |
| Micronuclear | + | 0.9500 | 95.00% |
| Hepatotoxicity | - | 0.5733 | 57.33% |
| skin sensitisation | - | 0.8608 | 86.08% |
| Respiratory toxicity | + | 0.7889 | 78.89% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.9250 | 92.50% |
| Nephrotoxicity | - | 0.6773 | 67.73% |
| Acute Oral Toxicity (c) | III | 0.4590 | 45.90% |
| Estrogen receptor binding | + | 0.6508 | 65.08% |
| Androgen receptor binding | + | 0.7067 | 70.67% |
| Thyroid receptor binding | + | 0.6097 | 60.97% |
| Glucocorticoid receptor binding | + | 0.6630 | 66.30% |
| Aromatase binding | + | 0.7174 | 71.74% |
| PPAR gamma | + | 0.7567 | 75.67% |
| Honey bee toxicity | - | 0.6939 | 69.39% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6500 | 65.00% |
| Fish aquatic toxicity | + | 0.9052 | 90.52% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 100.00% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.94% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.52% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.16% | 96.09% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 97.63% | 97.64% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.51% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.41% | 91.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.19% | 93.10% |
| CHEMBL2093869 | P05106 | Integrin alpha-IIb/beta-3 | 96.55% | 95.42% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 96.11% | 97.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 95.61% | 93.00% |
| CHEMBL4071 | P08311 | Cathepsin G | 95.54% | 94.64% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.51% | 90.08% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.36% | 90.20% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 95.24% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.58% | 95.56% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 93.35% | 92.50% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.24% | 90.71% |
| CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 91.70% | 94.36% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.48% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 91.25% | 95.93% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 91.01% | 96.67% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 90.85% | 95.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 90.57% | 82.38% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.11% | 90.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.06% | 95.50% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.24% | 97.25% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 88.49% | 88.56% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 88.13% | 97.64% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.60% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 87.55% | 91.03% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.34% | 93.56% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.09% | 94.45% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.98% | 99.17% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.71% | 91.19% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 85.66% | 97.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.64% | 99.15% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.47% | 96.11% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 85.20% | 83.10% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.18% | 100.00% |
| CHEMBL4447 | Q9Y337 | Kallikrein 5 | 85.07% | 87.50% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 84.49% | 96.90% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.34% | 85.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.30% | 99.18% |
| CHEMBL4633 | P22001 | Voltage-gated potassium channel subunit Kv1.3 | 84.14% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.48% | 95.50% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 82.94% | 80.71% |
| CHEMBL236 | P41143 | Delta opioid receptor | 81.68% | 99.35% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.89% | 100.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.61% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.46% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 16158208 |
| LOTUS | LTS0067258 |
| wikiData | Q3832559 |