Lignorene
| Internal ID | 03861c8f-10a4-4b34-bfc5-b0d08917053f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (1R,3S,4S,7R)-1,3,7-trimethyl-3-(4-methylpent-3-enyl)-2-oxabicyclo[2.2.1]heptane |
| SMILES (Canonical) | CC1C2CCC1(OC2(C)CCC=C(C)C)C |
| SMILES (Isomeric) | C[C@@H]1[C@@H]2CC[C@]1(O[C@@]2(C)CCC=C(C)C)C |
| InChI | InChI=1S/C15H26O/c1-11(2)7-6-9-15(5)13-8-10-14(4,16-15)12(13)3/h7,12-13H,6,8-10H2,1-5H3/t12-,13+,14-,15+/m1/s1 |
| InChI Key | RUTFUDNLIVHTDN-BARDWOONSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.198365449 g/mol |
| Topological Polar Surface Area (TPSA) | 9.20 Ų |
| XlogP | 4.20 |
| SCHEMBL20203781 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.99% | 96.09% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.86% | 89.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.29% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.34% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.02% | 97.25% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.05% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.94% | 97.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.28% | 92.94% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.45% | 90.17% |
| CHEMBL233 | P35372 | Mu opioid receptor | 82.02% | 97.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.03% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 134555475 |
| LOTUS | LTS0073992 |
| wikiData | Q77281137 |