Leucylproline
| Internal ID | 4f99d959-4ffb-4ea7-8ec8-29f09d5daee7 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| SMILES (Canonical) | CC(C)CC(C(=O)N1CCCC1C(=O)O)N |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N |
| InChI | InChI=1S/C11H20N2O3/c1-7(2)6-8(12)10(14)13-5-3-4-9(13)11(15)16/h7-9H,3-6,12H2,1-2H3,(H,15,16)/t8-,9-/m0/s1 |
| InChI Key | VTJUNIYRYIAIHF-IUCAKERBSA-N |
| Popularity | 92 references in papers |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 83.60 Ų |
| XlogP | -1.80 |
| l-leucyl-l-proline |
| Leu-pro |
| 6403-35-6 |
| CHEMBL189210 |
| CHEBI:73580 |
| (2S)-1-[(2S)-2-amino-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| leucyl-proline |
| H-Leu-Pro-OH |
| L-Leu-L-Pro |
| starbld0035034 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.84% | 97.25% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 96.69% | 98.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.59% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.87% | 98.33% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.88% | 96.47% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.64% | 90.17% |
| CHEMBL204 | P00734 | Thrombin | 88.54% | 96.01% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 88.48% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.35% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.43% | 96.95% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.24% | 96.03% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 87.07% | 98.24% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 87.05% | 93.56% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 86.26% | 98.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.19% | 91.19% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.40% | 83.82% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.01% | 99.18% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.68% | 90.71% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 83.21% | 90.24% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.89% | 100.00% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 82.64% | 91.76% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.61% | 89.63% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.50% | 90.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.86% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.15% | 95.89% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.88% | 94.33% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.48% | 93.04% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.35% | 92.29% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.31% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 80817 |
| LOTUS | LTS0221259 |
| wikiData | Q27141752 |