Leualacin G
| Internal ID | b2dd9a51-5ca1-419d-8690-f9f710103eeb |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (2R,5S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-2,8-bis(2-methylpropyl)-5-propan-2-yl-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)OC(C(=O)NC(C(=O)NCCC(=O)O1)CC2=CC=C(C=C2)O)CC(C)C)C(C)C |
| SMILES (Isomeric) | CC(C)C[C@@H]1C(=O)N[C@H](C(=O)O[C@H](C(=O)N[C@H](C(=O)NCCC(=O)O1)CC2=CC=C(C=C2)O)CC(C)C)C(C)C |
| InChI | InChI=1S/C29H43N3O8/c1-16(2)13-22-28(37)32-25(18(5)6)29(38)40-23(14-17(3)4)27(36)31-21(15-19-7-9-20(33)10-8-19)26(35)30-12-11-24(34)39-22/h7-10,16-18,21-23,25,33H,11-15H2,1-6H3,(H,30,35)(H,31,36)(H,32,37)/t21-,22+,23-,25-/m0/s1 |
| InChI Key | SGWWIXUVSLBONP-AANQFLQQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C29H43N3O8 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.30501534 g/mol |
| Topological Polar Surface Area (TPSA) | 160.00 Ų |
| XlogP | 4.20 |
| (2R,5S,8S,11S)-11-[(4-hydroxyphenyl)methyl]-2,8-bis(2-methylpropyl)-5-propan-2-yl-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| (2R,5S,8S,11S)-11-((4-hydroxyphenyl)methyl)-2,8-bis(2-methylpropyl)-5-propan-2-yl-1,7-dioxa-4,10,13-triazacyclohexadecane-3,6,9,12,16-pentone |
| RefChem:153034 |
| CHEBI:206743 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.07% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.78% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.52% | 91.11% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.15% | 90.08% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.46% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.84% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 93.57% | 97.79% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 93.52% | 89.67% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 93.40% | 90.93% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.56% | 88.56% |
| CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 89.06% | 99.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.66% | 95.93% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 88.64% | 98.35% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.27% | 97.25% |
| CHEMBL1949 | P62937 | Cyclophilin A | 87.56% | 98.57% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.15% | 95.56% |
| CHEMBL4616 | Q92847 | Ghrelin receptor | 86.79% | 92.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.32% | 98.59% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.80% | 85.14% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.67% | 93.10% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.20% | 95.89% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.42% | 85.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.34% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.09% | 95.89% |
| CHEMBL6175 | Q9H3R0 | Lysine-specific demethylase 4C | 82.57% | 96.69% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 81.44% | 83.10% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.05% | 94.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.57% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589667 |
| LOTUS | LTS0070096 |
| wikiData | Q105252684 |