Lespeflorin C5
Internal ID | 3538dba1-64e0-492a-941e-29f6b2e2c26b |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
IUPAC Name | (2S)-1-[2,4-dihydroxy-3-methyl-5-(3-methylbut-2-enyl)phenyl]-2-hydroxy-3-(4-hydroxyphenyl)propan-1-one |
SMILES (Canonical) | CC1=C(C(=CC(=C1O)C(=O)C(CC2=CC=C(C=C2)O)O)CC=C(C)C)O |
SMILES (Isomeric) | CC1=C(C(=CC(=C1O)C(=O)[C@H](CC2=CC=C(C=C2)O)O)CC=C(C)C)O |
InChI | InChI=1S/C21H24O5/c1-12(2)4-7-15-11-17(20(25)13(3)19(15)24)21(26)18(23)10-14-5-8-16(22)9-6-14/h4-6,8-9,11,18,22-25H,7,10H2,1-3H3/t18-/m0/s1 |
InChI Key | MSONJMHJAJGDCI-SFHVURJKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H24O5 |
Molecular Weight | 356.40 g/mol |
Exact Mass | 356.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 98.00 Ų |
XlogP | 4.70 |
CHEMBL552302 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.66% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.19% | 91.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 93.40% | 97.21% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.05% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.36% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.96% | 99.17% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 90.08% | 96.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.80% | 91.71% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 87.99% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.43% | 90.71% |
CHEMBL2535 | P11166 | Glucose transporter | 86.31% | 98.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.05% | 95.89% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.65% | 96.09% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.86% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.70% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.60% | 95.56% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.57% | 85.00% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.41% | 90.93% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 81.78% | 100.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.41% | 90.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.85% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lespedeza floribunda |
PubChem | 25243324 |
LOTUS | LTS0251287 |
wikiData | Q105171313 |