Lespedamine
| Internal ID | 37864499-f419-4e34-bfaa-bf3633cb3f8e |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Tryptamines and derivatives |
| IUPAC Name | 2-(1-methoxyindol-3-yl)-N,N-dimethylethanamine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C13H18N2O/c1-14(2)9-8-11-10-15(16-3)13-7-5-4-6-12(11)13/h4-7,10H,8-9H2,1-3H3 |
| InChI Key | DXTZTYQDNUHCAB-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.141913202 g/mol |
| Topological Polar Surface Area (TPSA) | 17.40 Ų |
| XlogP | 2.70 |
| 6W73QAN9CK |
| 4335-93-7 |
| UNII-6W73QAN9CK |
| 2-(1-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| 1-Methoxy-N,N-dimethyl-1H-indole-3-ethanamine |
| 1H-Indole-3-ethanamine, 1-methoxy-N,N-dimethyl- |
| SCHEMBL7500287 |
| DTXSID601031963 |
| 3-(dimethylaminoethyl)-1-methoxyindole |
| Q21099562 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 99.72% | 89.76% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.51% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.92% | 93.99% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.34% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.26% | 98.95% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 88.25% | 90.08% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 87.25% | 87.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.08% | 91.11% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.03% | 95.51% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.43% | 96.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.32% | 86.33% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 84.23% | 90.71% |
| CHEMBL4179 | P45984 | c-Jun N-terminal kinase 2 | 82.88% | 90.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.81% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.37% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lespedeza bicolor |
| PubChem | 11138594 |
| LOTUS | LTS0136392 |
| wikiData | Q21099562 |