Lentiginosine
| Internal ID | a452bea1-4884-437a-bfed-a278c66051d9 |
| Taxonomy | Organoheterocyclic compounds > Indolizidines |
| IUPAC Name | (1S,2S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| SMILES (Canonical) | C1CCN2CC(C(C2C1)O)O |
| SMILES (Isomeric) | C1CCN2C[C@@H]([C@H]([C@@H]2C1)O)O |
| InChI | InChI=1S/C8H15NO2/c10-7-5-9-4-2-1-3-6(9)8(7)11/h6-8,10-11H,1-5H2/t6-,7-,8-/m0/s1 |
| InChI Key | SQECYPINZNWUTE-FXQIFTODSA-N |
| Popularity | 45 references in papers |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.110278721 g/mol |
| Topological Polar Surface Area (TPSA) | 43.70 Ų |
| XlogP | -0.30 |
| (1S,2S,8aS)-Octahydroindolizine-1,2-diol |
| 161024-43-7 |
| C10155 |
| CHEBI:6409 |
| SCHEMBL1676056 |
| Q27107196 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.64% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.98% | 96.09% |
| CHEMBL3023 | Q9NRA0 | Sphingosine kinase 2 | 87.68% | 95.61% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.39% | 92.94% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.99% | 95.89% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.95% | 98.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.31% | 98.95% |
| CHEMBL3746 | P80365 | 11-beta-hydroxysteroid dehydrogenase 2 | 85.96% | 94.78% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 85.66% | 96.03% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.51% | 93.03% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 83.10% | 93.04% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.47% | 97.09% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 81.12% | 98.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.04% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arachis hypogaea |
| Astragalus lentiginosus |
| Glycine max |
| PubChem | 442645 |
| LOTUS | LTS0275747 |
| wikiData | Q105003606 |