Lemobiline
| Internal ID | fc9f063f-1ada-42ba-bda9-1d03b103ce7a |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Dihydrofuranoquinolines |
| IUPAC Name | 2,2,3,9-tetramethyl-3H-furo[2,3-b]quinolin-4-one |
| SMILES (Canonical) | CC1C2=C(N(C3=CC=CC=C3C2=O)C)OC1(C)C |
| SMILES (Isomeric) | CC1C2=C(N(C3=CC=CC=C3C2=O)C)OC1(C)C |
| InChI | InChI=1S/C15H17NO2/c1-9-12-13(17)10-7-5-6-8-11(10)16(4)14(12)18-15(9,2)3/h5-9H,1-4H3 |
| InChI Key | BXTFNWWMVUHWQA-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.125928785 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 2.90 |
| Lemobilin |
| 26126-76-1 |
| UNII-5DW29TQV25 |
| 5DW29TQV25 |
| C10705 |
| FURO(2,3-b)quinolin-4(2H)-one, 3,9-dihydro-2,2,3,9-tetramethyl-, (-)- |
| 2,2,3,9-tetramethyl-3H-furo[2,3-b]quinolin-4-one |
| 2,2,3,9-tetramethyl-3,9-dihydrofuro[2,3-b]quinolin-4(2H)-one |
| Furo[2,3-b]quinolin-4(2H)-one, 3,9-dihydro-2,2,3,9-tetramethyl-, (-)- |
| AC1L9DN5 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.44% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.63% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.24% | 97.25% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.98% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.41% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.44% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.07% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.63% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 83.78% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.89% | 91.11% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 82.88% | 97.63% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.54% | 98.59% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euxylophora paraensis |
| Flindersia ifflana |
| PubChem | 442917 |
| LOTUS | LTS0171254 |
| wikiData | Q27107195 |