laxaphycin B3
| Internal ID | 389ec25a-c311-40a2-8554-893a9b10d1bf |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[(3S,6R,15R,21S,24S,28R,31S,37S,39R)-6-[(1R)-2-amino-1-hydroxy-2-oxoethyl]-9-[(2S)-butan-2-yl]-28-heptyl-39-hydroxy-31-(1-hydroxyethyl)-3-[(1R)-1-hydroxyethyl]-21-[(1S)-1-hydroxy-2-methylpropyl]-15-(1-hydroxy-2-methylpropyl)-10,18-dimethyl-34-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo[35.3.0]tetracontan-12-yl]propanamide |
| SMILES (Canonical) | CCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N2CC(CC2C(=O)NC(C(=O)NC(C(=O)N1)C(C)O)CC(C)C)O)C(C)O)C(C(=O)N)O)C(C)CC)C)CCC(=O)N)C(C(C)C)O)C)C(C(C)C)O)C(C)C |
| SMILES (Isomeric) | CCCCCCC[C@@H]1CC(=O)N[C@H](C(=O)N[C@H](C(=O)NC(C(=O)N[C@@H](C(=O)NC(C(=O)N(C(C(=O)N[C@@H](C(=O)N[C@H](C(=O)N2C[C@@H](C[C@H]2C(=O)NC(C(=O)N[C@H](C(=O)N1)C(C)O)CC(C)C)O)[C@@H](C)O)[C@H](C(=O)N)O)[C@@H](C)CC)C)CCC(=O)N)C(C(C)C)O)C)[C@H](C(C)C)O)C(C)C |
| InChI | InChI=1S/C65H114N14O20/c1-16-18-19-20-21-22-37-26-43(84)72-44(30(5)6)58(92)76-47(51(85)31(7)8)60(94)68-34(12)55(89)75-48(52(86)32(9)10)61(95)70-39(23-24-42(66)83)64(98)78(15)50(33(11)17-2)63(97)77-49(53(87)54(67)88)62(96)74-46(36(14)81)65(99)79-28-38(82)27-41(79)57(91)71-40(25-29(3)4)56(90)73-45(35(13)80)59(93)69-37/h29-41,44-53,80-82,85-87H,16-28H2,1-15H3,(H2,66,83)(H2,67,88)(H,68,94)(H,69,93)(H,70,95)(H,71,91)(H,72,84)(H,73,90)(H,74,96)(H,75,89)(H,76,92)(H,77,97)/t33-,34?,35?,36+,37+,38+,39?,40?,41-,44-,45-,46-,47-,48+,49+,50?,51-,52?,53+/m0/s1 |
| InChI Key | MRTGWORMQOZSMV-BYCMVUIZSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C65H114N14O20 |
| Molecular Weight | 1411.70 g/mol |
| Exact Mass | 1410.83338208 g/mol |
| Topological Polar Surface Area (TPSA) | 539.00 Ų |
| XlogP | 2.00 |
| Atomic LogP (AlogP) | -4.94 |
| H-Bond Acceptor | 20 |
| H-Bond Donor | 18 |
| Rotatable Bonds | 22 |
| DTXSID201046586 |
| RefChem:152564 |
| DTXCID201528411 |
| 3-((3S,6R,9S,12S,15R,18S,21S,24S,28R,31S,34R,37S,39R)-6-((1R)-2-amino-1-hydroxy-2-oxoethyl)-9-((2S)-butan-2-yl)-28-heptyl-39-hydroxy-3,31-bis((1R)-1-hydroxyethyl)-15,21-bis((1S)-1-hydroxy-2-methylpropyl)-10,18-dimethyl-34-(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo(35.3.0)tetracontan-12-yl)propanamide |
| CHEBI:216611 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8599 | 85.99% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.4221 | 42.21% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8041 | 80.41% |
| OATP1B3 inhibitior | + | 0.8803 | 88.03% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9366 | 93.66% |
| P-glycoprotein inhibitior | + | 0.7415 | 74.15% |
| P-glycoprotein substrate | + | 0.8886 | 88.86% |
| CYP3A4 substrate | + | 0.7330 | 73.30% |
| CYP2C9 substrate | - | 0.6033 | 60.33% |
| CYP2D6 substrate | - | 0.8122 | 81.22% |
| CYP3A4 inhibition | - | 0.9159 | 91.59% |
| CYP2C9 inhibition | - | 0.9051 | 90.51% |
| CYP2C19 inhibition | - | 0.9110 | 91.10% |
| CYP2D6 inhibition | - | 0.9391 | 93.91% |
| CYP1A2 inhibition | - | 0.9329 | 93.29% |
| CYP2C8 inhibition | + | 0.7242 | 72.42% |
| CYP inhibitory promiscuity | - | 0.9956 | 99.56% |
| UGT catelyzed | + | 1.0000 | 100.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6273 | 62.73% |
| Eye corrosion | - | 0.9871 | 98.71% |
| Eye irritation | - | 0.8957 | 89.57% |
| Skin irritation | - | 0.7777 | 77.77% |
| Skin corrosion | - | 0.9014 | 90.14% |
| Ames mutagenesis | - | 0.6100 | 61.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6621 | 66.21% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | + | 0.6212 | 62.12% |
| skin sensitisation | - | 0.8808 | 88.08% |
| Respiratory toxicity | + | 0.7556 | 75.56% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7375 | 73.75% |
| Nephrotoxicity | - | 0.8043 | 80.43% |
| Acute Oral Toxicity (c) | III | 0.6888 | 68.88% |
| Estrogen receptor binding | + | 0.6744 | 67.44% |
| Androgen receptor binding | + | 0.7248 | 72.48% |
| Thyroid receptor binding | + | 0.5709 | 57.09% |
| Glucocorticoid receptor binding | + | 0.7184 | 71.84% |
| Aromatase binding | + | 0.7506 | 75.06% |
| PPAR gamma | + | 0.7885 | 78.85% |
| Honey bee toxicity | - | 0.7096 | 70.96% |
| Biodegradation | - | 0.7250 | 72.50% |
| Crustacea aquatic toxicity | + | 0.5518 | 55.18% |
| Fish aquatic toxicity | - | 0.5454 | 54.54% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.84% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.54% | 96.09% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 98.69% | 98.03% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.59% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 97.20% | 97.79% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 96.84% | 90.24% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 96.63% | 97.29% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 96.62% | 91.81% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 95.43% | 90.08% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.94% | 97.64% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.92% | 95.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.87% | 97.09% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.71% | 92.08% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.48% | 94.75% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.38% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.26% | 92.86% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
| CHEMBL1949 | P62937 | Cyclophilin A | 94.19% | 98.57% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.89% | 90.71% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.69% | 96.47% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 93.49% | 82.69% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 92.54% | 97.63% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 91.78% | 82.38% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.49% | 93.56% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 90.95% | 94.00% |
| CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 88.98% | 80.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.89% | 95.71% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.49% | 95.50% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.07% | 93.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.26% | 100.00% |
| CHEMBL228 | P31645 | Serotonin transporter | 86.09% | 95.51% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.08% | 86.33% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 86.03% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.88% | 95.56% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.08% | 94.45% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.68% | 96.11% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 82.85% | 94.50% |
| CHEMBL4071 | P08311 | Cathepsin G | 82.83% | 94.64% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.39% | 96.95% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 82.32% | 97.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.00% | 97.14% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.84% | 97.21% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 81.74% | 94.66% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.59% | 92.32% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 81.12% | 94.55% |
| CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 80.91% | 88.33% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.82% | 97.23% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.50% | 99.23% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.48% | 100.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.40% | 91.11% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.24% | 97.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 22833265 |
| LOTUS | LTS0053635 |
| wikiData | Q77564494 |