Laxaphycin B2
| Internal ID | 7e25146d-5346-4c1a-afda-7d2419a9dc99 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Oligopeptides |
| IUPAC Name | 3-[(3S,6R,15R,21R,24S,28R,31S,37S)-6-[(1R)-2-amino-1-hydroxy-2-oxoethyl]-9-[(2S)-butan-2-yl]-28-heptyl-31-(1-hydroxyethyl)-3-[(1R)-1-hydroxyethyl]-21-[(1S)-1-hydroxy-2-methylpropyl]-10,18-dimethyl-15,34-bis(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo[35.3.0]tetracontan-12-yl]propanamide |
| SMILES (Canonical) | CCCCCCCC1CC(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)NC(C(=O)N1)C(C)O)CC(C)C)C(C)O)C(C(=O)N)O)C(C)CC)C)CCC(=O)N)CC(C)C)C)C(C(C)C)O)C(C)C |
| SMILES (Isomeric) | CCCCCCC[C@@H]1CC(=O)N[C@H](C(=O)N[C@@H](C(=O)NC(C(=O)N[C@@H](C(=O)NC(C(=O)N(C(C(=O)N[C@@H](C(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)NC(C(=O)N[C@H](C(=O)N1)C(C)O)CC(C)C)[C@@H](C)O)[C@H](C(=O)N)O)[C@@H](C)CC)C)CCC(=O)N)CC(C)C)C)[C@H](C(C)C)O)C(C)C |
| InChI | InChI=1S/C65H114N14O18/c1-16-18-19-20-21-23-39-30-45(83)73-46(33(7)8)59(91)76-49(52(84)34(9)10)61(93)68-36(12)55(87)71-41(28-31(3)4)56(88)70-40(25-26-44(66)82)64(96)78(15)51(35(11)17-2)63(95)77-50(53(85)54(67)86)62(94)75-48(38(14)81)65(97)79-27-22-24-43(79)58(90)72-42(29-32(5)6)57(89)74-47(37(13)80)60(92)69-39/h31-43,46-53,80-81,84-85H,16-30H2,1-15H3,(H2,66,82)(H2,67,86)(H,68,93)(H,69,92)(H,70,88)(H,71,87)(H,72,90)(H,73,83)(H,74,89)(H,75,94)(H,76,91)(H,77,95)/t35-,36?,37?,38+,39+,40?,41+,42?,43-,46-,47-,48-,49+,50+,51?,52-,53+/m0/s1 |
| InChI Key | ZGEFAENLWOFMKR-YZVLHJFSSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C65H114N14O18 |
| Molecular Weight | 1379.70 g/mol |
| Exact Mass | 1378.84355284 g/mol |
| Topological Polar Surface Area (TPSA) | 499.00 Ų |
| XlogP | 3.40 |
| Atomic LogP (AlogP) | -2.88 |
| H-Bond Acceptor | 18 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 22 |
| DTXSID701334148 |
| RefChem:152563 |
| DTXCID901763545 |
| 3-((3S,6R,15R,21R,24S,28R,31S,37S)-6-((1R)-2-amino-1-hydroxy-2-oxoethyl)-9-((2S)-butan-2-yl)-28-heptyl-31-(1-hydroxyethyl)-3-((1R)-1-hydroxyethyl)-21-((1S)-1-hydroxy-2-methylpropyl)-10,18-dimethyl-15,34-bis(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo(35.3.0)tetracontan-12-yl)propanamide |
| 3-((3S,6R,9S,12S,15R,18S,21R,24S,28R,31S,34R,37S)-6-((1R)-2-amino-1-hydroxy-2-oxoethyl)-9-((2S)-butan-2-yl)-28-heptyl-3,31-bis((1R)-1-hydroxyethyl)-21-((1S)-1-hydroxy-2-methylpropyl)-10,18-dimethyl-15,34-bis(2-methylpropyl)-2,5,8,11,14,17,20,23,26,30,33,36-dodecaoxo-24-propan-2-yl-1,4,7,10,13,16,19,22,25,29,32,35-dodecazabicyclo(35.3.0)tetracontan-12-yl)propanamide |
| SCHEMBL29884441 |
| CHEBI:198885 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5000 | 50.00% |
| Caco-2 | - | 0.8597 | 85.97% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7714 | 77.14% |
| Subcellular localzation | Mitochondria | 0.4221 | 42.21% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8130 | 81.30% |
| OATP1B3 inhibitior | + | 0.8803 | 88.03% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.9000 | 90.00% |
| BSEP inhibitior | + | 0.9207 | 92.07% |
| P-glycoprotein inhibitior | + | 0.7414 | 74.14% |
| P-glycoprotein substrate | + | 0.8806 | 88.06% |
| CYP3A4 substrate | + | 0.7288 | 72.88% |
| CYP2C9 substrate | - | 0.6033 | 60.33% |
| CYP2D6 substrate | - | 0.8122 | 81.22% |
| CYP3A4 inhibition | - | 0.9159 | 91.59% |
| CYP2C9 inhibition | - | 0.9051 | 90.51% |
| CYP2C19 inhibition | - | 0.9110 | 91.10% |
| CYP2D6 inhibition | - | 0.9391 | 93.91% |
| CYP1A2 inhibition | - | 0.9329 | 93.29% |
| CYP2C8 inhibition | + | 0.7263 | 72.63% |
| CYP inhibitory promiscuity | - | 0.9956 | 99.56% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6273 | 62.73% |
| Eye corrosion | - | 0.9871 | 98.71% |
| Eye irritation | - | 0.8958 | 89.58% |
| Skin irritation | - | 0.7777 | 77.77% |
| Skin corrosion | - | 0.9014 | 90.14% |
| Ames mutagenesis | - | 0.6200 | 62.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6524 | 65.24% |
| Micronuclear | + | 0.7700 | 77.00% |
| Hepatotoxicity | + | 0.6712 | 67.12% |
| skin sensitisation | - | 0.8808 | 88.08% |
| Respiratory toxicity | + | 0.6333 | 63.33% |
| Reproductive toxicity | + | 0.8889 | 88.89% |
| Mitochondrial toxicity | + | 0.7375 | 73.75% |
| Nephrotoxicity | - | 0.8083 | 80.83% |
| Acute Oral Toxicity (c) | III | 0.6888 | 68.88% |
| Estrogen receptor binding | + | 0.6922 | 69.22% |
| Androgen receptor binding | + | 0.7045 | 70.45% |
| Thyroid receptor binding | + | 0.5483 | 54.83% |
| Glucocorticoid receptor binding | + | 0.6982 | 69.82% |
| Aromatase binding | + | 0.7491 | 74.91% |
| PPAR gamma | + | 0.7836 | 78.36% |
| Honey bee toxicity | - | 0.7529 | 75.29% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | + | 0.5242 | 52.42% |
| Fish aquatic toxicity | - | 0.5454 | 54.54% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.90% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.25% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.86% | 97.25% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 98.28% | 90.24% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.97% | 90.08% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 96.71% | 91.81% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 96.54% | 97.64% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 95.66% | 82.38% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 95.48% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.19% | 94.75% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 94.57% | 98.03% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 94.28% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.92% | 97.09% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.83% | 96.47% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 93.66% | 95.50% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 93.50% | 95.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.47% | 97.29% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.28% | 90.71% |
| CHEMBL1949 | P62937 | Cyclophilin A | 92.27% | 98.57% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.05% | 96.31% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.91% | 93.56% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 91.83% | 97.79% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.80% | 99.17% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 89.93% | 94.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.52% | 95.89% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.06% | 92.86% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.72% | 82.69% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 88.55% | 93.03% |
| CHEMBL228 | P31645 | Serotonin transporter | 88.55% | 95.51% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 88.48% | 100.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 88.38% | 93.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 88.03% | 99.18% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 87.78% | 97.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.65% | 95.56% |
| CHEMBL4071 | P08311 | Cathepsin G | 87.41% | 94.64% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.27% | 95.62% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 86.03% | 92.97% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 85.86% | 96.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.55% | 94.66% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 85.44% | 96.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.75% | 94.45% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 84.61% | 97.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.50% | 86.33% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.49% | 97.47% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.42% | 98.46% |
| CHEMBL3045 | P05771 | Protein kinase C beta | 83.60% | 97.63% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.19% | 92.08% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 82.70% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.21% | 99.23% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 82.16% | 98.33% |
| CHEMBL238 | Q01959 | Dopamine transporter | 80.78% | 95.88% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.52% | 97.50% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.49% | 92.94% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.18% | 91.11% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.00% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 22833264 |
| LOTUS | LTS0260667 |
| wikiData | Q75063546 |