Lavanducyanin
| Internal ID | e784a5ce-60bd-4caa-8ba4-531257d620e9 |
| Taxonomy | Organoheterocyclic compounds > Diazanaphthalenes > Benzodiazines > Quinoxalines > Phenazines and derivatives |
| IUPAC Name | 5-[(2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one |
| SMILES (Canonical) | CC1=C(CCC(C1)(C)C)CN2C3=CC=CC=C3N=C4C2=CC=CC4=O |
| SMILES (Isomeric) | CC1=C(CCC(C1)(C)C)CN2C3=CC=CC=C3N=C4C2=CC=CC4=O |
| InChI | InChI=1S/C22H24N2O/c1-15-13-22(2,3)12-11-16(15)14-24-18-8-5-4-7-17(18)23-21-19(24)9-6-10-20(21)25/h4-10H,11-14H2,1-3H3 |
| InChI Key | AMQJGKJHNQVSQU-UHFFFAOYSA-N |
| Popularity | 11 references in papers |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.188863393 g/mol |
| Topological Polar Surface Area (TPSA) | 32.70 Ų |
| XlogP | 4.10 |
| 122228-60-8 |
| WS 9659A |
| WS-9659A |
| LG9Y6UJ2UN |
| 5-[(2,4,4-trimethylcyclohexen-1-yl)methyl]phenazin-1-one |
| 1(5H)-Phenazinone, 5-((2,4,4-trimethyl-1-cyclohexen-1-yl)methyl)- |
| 5-((2,4,4-Trimethyl-1-cyclohexen-1-yl)methyl)-1(5H)-phenazinone |
| DTXSID40153549 |
| 5-((2,4,4-trimethylcyclohexen-1-yl)methyl)phenazin-1-one |
| RefChem:152546 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.82% | 93.99% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.39% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.27% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.79% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.85% | 98.95% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.67% | 92.98% |
| CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 92.82% | 85.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.97% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.32% | 98.59% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 88.32% | 96.67% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.98% | 94.75% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 86.38% | 89.63% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 85.95% | 93.40% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.80% | 91.71% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 83.63% | 96.25% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 83.23% | 92.97% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.84% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.71% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 81.77% | 93.31% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 80.25% | 96.39% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 129607 |
| LOTUS | LTS0075621 |
| wikiData | Q83020489 |