Laurebiphenyl
| Internal ID | 610c3082-82c6-47c2-bdb8-0f7bf6f31d6d |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 2-[(1S,2R,5R)-1,2-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-[5-[(1S,2R,5R)-1,2-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-hydroxy-2-methylphenyl]-5-methylphenol |
| SMILES (Canonical) | CC1=CC(=C(C=C1C2=CC(=C(C=C2C)O)C3(CCC4C3(C4)C)C)C5(CCC6C5(C6)C)C)O |
| SMILES (Isomeric) | CC1=CC(=C(C=C1C2=CC(=C(C=C2C)O)[C@@]3(CC[C@H]4[C@@]3(C4)C)C)[C@@]5(CC[C@H]6[C@@]5(C6)C)C)O |
| InChI | InChI=1S/C30H38O2/c1-17-11-25(31)23(27(3)9-7-19-15-29(19,27)5)13-21(17)22-14-24(26(32)12-18(22)2)28(4)10-8-20-16-30(20,28)6/h11-14,19-20,31-32H,7-10,15-16H2,1-6H3/t19-,20-,27+,28+,29+,30+/m1/s1 |
| InChI Key | XNIZFYLMUVNEOT-MUVIMXQCSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C30H38O2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.287180451 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 8.90 |
| CHEBI:66554 |
| 5,5'-bis[(1S,2R,5R)-1,2-dimethylbicyclo[3.1.0]hex-2-yl]-2,2'-dimethylbiphenyl-4,4'-diol |
| 2-[(1S,2R,5R)-1,2-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-[5-[(1S,2R,5R)-1,2-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-hydroxy-2-methylphenyl]-5-methylphenol |
| 2-((1S,2R,5R)-1,2-dimethyl-2-bicyclo(3.1.0)hexanyl)-4-(5-((1S,2R,5R)-1,2-dimethyl-2-bicyclo(3.1.0)hexanyl)-4-hydroxy-2-methylphenyl)-5-methylphenol |
| 5,5'-bis((1S,2R,5R)-1,2-dimethylbicyclo(3.1.0)hex-2-yl)-2,2'-dimethylbiphenyl-4,4'-diol |
| RefChem:152484 |
| 97649-04-2 |
| CHEMBL463338 |
| Q27135164 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.84% | 91.11% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 93.04% | 93.40% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.45% | 91.49% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.08% | 96.09% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.95% | 92.94% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 89.53% | 91.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.05% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.24% | 97.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.13% | 95.89% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.01% | 94.75% |
| CHEMBL1913 | P09619 | Platelet-derived growth factor receptor beta | 86.01% | 95.70% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.45% | 90.24% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.08% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.13% | 90.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.56% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.59% | 99.15% |
| CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.81% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11532074 |
| LOTUS | LTS0082468 |
| wikiData | Q27135164 |