Lateritin
| Internal ID | ef2c6214-68e4-411d-902a-a603b7d92f4a |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Alpha amino acid esters |
| IUPAC Name | 3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| SMILES (Canonical) | CC(C)C1C(=O)N(C(C(=O)O1)CC2=CC=CC=C2)C |
| SMILES (Isomeric) | CC(C)C1C(=O)N(C(C(=O)O1)CC2=CC=CC=C2)C |
| InChI | InChI=1S/C15H19NO3/c1-10(2)13-14(17)16(3)12(15(18)19-13)9-11-7-5-4-6-8-11/h4-8,10,12-13H,9H2,1-3H3 |
| InChI Key | YOKBTBNVNCFOBF-UHFFFAOYSA-N |
| Popularity | 12 references in papers |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 46.60 Ų |
| XlogP | 2.80 |
| 65454-13-9 |
| (3S,6R)-Lateritin |
| 3-BENZYL-6-ISOPROPYL-4-METHYLMORPHOLINE-2,5-DIONE |
| Antibiotic PI290 |
| 2,5-Morpholinedione, 4-methyl-6-(1-methylethyl)-3-(phenylmethyl)- |
| 3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| 3-Benzyl-4-methyl-6-(propan-2-yl)morpholine-2,5-dione |
| DTXSID80984071 |
| HB3694 |
| 4-Methyl-6-(1-methylethyl)-3-phenylmethyl-1,4-perhydrooxazine-2,5-dione |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.90% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.46% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.82% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.92% | 85.14% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.15% | 85.94% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 84.06% | 91.76% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.47% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 80.55% | 97.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Micromeles japonica |
| PubChem | 194215 |
| LOTUS | LTS0201724 |
| wikiData | Q77559627 |