Lasiodonin acetonide
Internal ID | da0d4bc8-3d29-4002-97f3-9e6c83a60a4d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Kaurane diterpenoids |
IUPAC Name | (1S,2S,3R,6S,7S,8R,12S,16S,18R)-6,7-dihydroxy-9,9,14,14-tetramethyl-19-methylidene-5,13,15-trioxahexacyclo[16.2.1.01,6.02,16.03,8.03,12]henicosan-20-one |
SMILES (Canonical) | CC1(CCC2C34C1C(C(C56C3C(CC(C5)C(=C)C6=O)OC(O2)(C)C)(OC4)O)O)C |
SMILES (Isomeric) | CC1(CC[C@H]2[C@]34[C@@H]1[C@@H]([C@]([C@]56[C@H]3[C@H](C[C@@H](C5)C(=C)C6=O)OC(O2)(C)C)(OC4)O)O)C |
InChI | InChI=1S/C23H32O6/c1-11-12-8-13-15-21-10-27-23(26,22(15,9-12)17(11)24)18(25)16(21)19(2,3)7-6-14(21)29-20(4,5)28-13/h12-16,18,25-26H,1,6-10H2,2-5H3/t12-,13-,14-,15-,16+,18-,21-,22-,23+/m0/s1 |
InChI Key | FTUVGFINORCONN-AWHSDHHNSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C23H32O6 |
Molecular Weight | 404.50 g/mol |
Exact Mass | 404.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 1.50 |
CHEBI:67678 |
Q27136150 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.72% | 94.75% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.68% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.38% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.17% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.64% | 97.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.06% | 100.00% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 88.04% | 95.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.11% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.90% | 99.23% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.91% | 90.08% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.66% | 97.25% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.37% | 94.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.11% | 93.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.36% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.28% | 95.56% |
CHEMBL1907601 | P11802 | Cyclin-dependent kinase 4/cyclin D1 | 81.20% | 98.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.07% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.56% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Isodon rubescens |
PubChem | 70697945 |
LOTUS | LTS0112580 |
wikiData | Q27136150 |