Lansiumarin B
Internal ID | 3e39b775-c284-493d-afdc-da12a3489cd8 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives > Furanocoumarins > Psoralens |
IUPAC Name | 9-[(2E,5E)-7-hydroperoxy-3,7-dimethylocta-2,5-dienoxy]furo[3,2-g]chromen-7-one |
SMILES (Canonical) | CC(=CCOC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)CC=CC(C)(C)OO |
SMILES (Isomeric) | C/C(=C\COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)/C/C=C/C(C)(C)OO |
InChI | InChI=1S/C21H22O6/c1-14(5-4-10-21(2,3)27-23)8-11-25-20-18-16(9-12-24-18)13-15-6-7-17(22)26-19(15)20/h4,6-10,12-13,23H,5,11H2,1-3H3/b10-4+,14-8+ |
InChI Key | NNZMYFZCHMIZMN-OVXNXNIRSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H22O6 |
Molecular Weight | 370.40 g/mol |
Exact Mass | 370.14163842 g/mol |
Topological Polar Surface Area (TPSA) | 78.10 Ų |
XlogP | 3.80 |
CHEBI:175760 |
DTXSID501117041 |
205115-74-8 |
9-[(2E,5E)-7-hydroperoxy-3,7-dimethylocta-2,5-dienoxy]uro[3,2-g]chromen-7-one |
9-[[(2E,5E)-7-Hydroperoxy-3,7-dimethyl-2,5-octadien-1-yl]oxy]-7H-furo[3,2-g][1]benzopyran-7-one |
9-{[(2E,5E)-7-hydroperoxy-3,7-dimethylocta-2,5-dien-1-yl]oxy}-2H-furo[3,2-g]chromen-2-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.27% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 94.60% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.52% | 94.75% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.29% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.12% | 94.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 91.11% | 89.34% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.20% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.30% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.67% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.10% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.49% | 89.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.43% | 96.95% |
CHEMBL240 | Q12809 | HERG | 82.33% | 89.76% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.08% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clausena lansium |
PubChem | 10499386 |
LOTUS | LTS0037181 |
wikiData | Q76415754 |