Landomycin B
| Internal ID | e7a4861f-4aba-4c9b-a6da-58d5da029f54 |
| Taxonomy | Benzenoids > Anthracenes > Anthraquinones |
| IUPAC Name | (6R)-8-[(2S,4R,5S,6R)-5-[(2S,4R,5R,6R)-4-[(2S,5S,6S)-5-[(2S,4R,5S,6R)-5-[(2S,4R,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-5-hydroxy-6-methyloxan-2-yl]oxy-4-hydroxy-6-methyloxan-2-yl]oxy-1,6,11-trihydroxy-3-methyl-5,6-dihydrobenzo[a]anthracene-7,12-dione |
| SMILES (Canonical) | CC1C(CCC(O1)OC2CC(OC(C2O)C)OC3C(OC(CC3O)OC4=C5C(=C(C=C4)O)C(=O)C6=C(C5=O)C(CC7=C6C(=CC(=C7)C)O)O)C)OC8CC(C(C(O8)C)OC9CC(C(C(O9)C)O)O)O |
| SMILES (Isomeric) | C[C@H]1[C@H](CC[C@@H](O1)O[C@@H]2C[C@@H](O[C@@H]([C@H]2O)C)O[C@@H]3[C@H](O[C@H](C[C@H]3O)OC4=C5C(=C(C=C4)O)C(=O)C6=C(C5=O)[C@@H](CC7=C6C(=CC(=C7)C)O)O)C)O[C@H]8C[C@H]([C@@H]([C@H](O8)C)O[C@H]9C[C@H]([C@@H]([C@H](O9)C)O)O)O |
| InChI | InChI=1S/C49H64O20/c1-18-11-24-13-27(52)41-43(39(24)26(51)12-18)47(59)40-25(50)7-8-32(42(40)46(41)58)66-36-16-30(55)49(23(6)64-36)69-38-17-33(45(57)21(4)62-38)67-34-10-9-31(19(2)60-34)65-35-15-29(54)48(22(5)63-35)68-37-14-28(53)44(56)20(3)61-37/h7-8,11-12,19-23,27-31,33-38,44-45,48-57H,9-10,13-17H2,1-6H3/t19-,20+,21+,22+,23+,27+,28+,29+,30+,31-,33+,34-,35-,36-,37-,38-,44+,45+,48+,49+/m0/s1 |
| InChI Key | PUFYJURQQMRQDS-RPLDIEPASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C49H64O20 |
| Molecular Weight | 973.00 g/mol |
| Exact Mass | 972.39909443 g/mol |
| Topological Polar Surface Area (TPSA) | 288.00 Ų |
| XlogP | 2.30 |
| CHEBI:70062 |
| CHEMBL1668768 |
| C18823 |
| Q27138401 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.52% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.62% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.31% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.63% | 95.89% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 92.46% | 96.38% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.42% | 90.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.81% | 96.95% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.65% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.57% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.02% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.95% | 99.23% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 90.48% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.63% | 90.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.41% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.64% | 86.33% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.12% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.14% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.76% | 96.09% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.66% | 97.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.86% | 95.89% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.80% | 91.03% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.20% | 83.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53297405 |
| LOTUS | LTS0086115 |
| wikiData | Q27138401 |