Lancifodilactone J
| Internal ID | 5ed1b1b2-3266-4942-b91e-6d5c7b75029a |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
| IUPAC Name | [(1S,3R,7R,10S,12S,13R,15S,16S,17S,18S,20S)-15-hydroxy-9,9,18,20-tetramethyl-17-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-5,14,19-trioxo-4,8,23-trioxahexacyclo[13.7.1.01,13.03,7.03,10.016,20]tricosan-12-yl] acetate |
| SMILES (Canonical) | CC1C(C2C(C1=O)(CCC34CC56C(CC(C3C(=O)C2(O4)O)OC(=O)C)C(OC5CC(=O)O6)(C)C)C)C7C=C(C(=O)O7)C |
| SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]2[C@@](C1=O)(CC[C@]34C[C@@]56[C@@H](C[C@@H]([C@H]3C(=O)[C@]2(O4)O)OC(=O)C)C(O[C@@H]5CC(=O)O6)(C)C)C)[C@@H]7C=C(C(=O)O7)C |
| InChI | InChI=1S/C31H38O11/c1-13-9-16(39-26(13)36)21-14(2)24(34)28(6)7-8-29-12-30-18(27(4,5)40-19(30)11-20(33)41-30)10-17(38-15(3)32)22(29)25(35)31(37,42-29)23(21)28/h9,14,16-19,21-23,37H,7-8,10-12H2,1-6H3/t14-,16-,17-,18-,19+,21+,22-,23-,28-,29-,30+,31-/m0/s1 |
| InChI Key | RXNQFRVLPNMCHU-VJZLCUFQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C31H38O11 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.24141202 g/mol |
| Topological Polar Surface Area (TPSA) | 152.00 Ų |
| XlogP | 1.10 |
| CHEMBL510575 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.79% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.72% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.79% | 86.33% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.48% | 94.75% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.24% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.91% | 96.09% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.46% | 97.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.45% | 99.23% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.97% | 97.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.55% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.41% | 89.00% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 84.77% | 95.92% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.78% | 97.25% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.77% | 94.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.75% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.70% | 95.89% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 82.63% | 90.93% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.55% | 91.19% |
| CHEMBL5028 | O14672 | ADAM10 | 82.33% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.44% | 97.09% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.42% | 97.28% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.17% | 91.07% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.14% | 94.08% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.15% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schisandra lancifolia |
| PubChem | 11657186 |
| LOTUS | LTS0208636 |
| wikiData | Q105247181 |