Lanatoside E
Internal ID | 2b745052-282e-42b8-84c4-2366ab3227a9 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | [(2R,3R,4S,6S)-6-[(2R,3S,4S,6S)-6-[(2R,3S,4S,6R)-6-[[(3S,5R,8R,9S,10S,13R,14S,16S,17R)-16-formyloxy-14-hydroxy-10,13-dimethyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]-4-hydroxy-2-methyloxan-3-yl]oxy-4-hydroxy-2-methyloxan-3-yl]oxy-2-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl] acetate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CC(C5C6=CC(=O)OC6)OC=O)O)C)C)O)OC7CC(C(C(O7)C)OC8CC(C(C(O8)C)OC9C(C(C(C(O9)CO)O)O)O)OC(=O)C)O |
SMILES (Isomeric) | C[C@@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(C[C@@H]([C@@H]5C6=CC(=O)OC6)OC=O)O)C)C)O)O[C@H]7C[C@@H]([C@@H]([C@H](O7)C)O[C@H]8C[C@@H]([C@@H]([C@H](O8)C)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)OC(=O)C)O |
InChI | InChI=1S/C50H76O21/c1-22-44(69-38-16-32(55)45(23(2)64-38)70-39-17-33(66-25(4)53)46(24(3)65-39)71-47-43(59)42(58)41(57)35(19-51)68-47)31(54)15-37(63-22)67-28-9-11-48(5)27(14-28)7-8-30-29(48)10-12-49(6)40(26-13-36(56)61-20-26)34(62-21-52)18-50(30,49)60/h13,21-24,27-35,37-47,51,54-55,57-60H,7-12,14-20H2,1-6H3/t22-,23-,24-,27-,28+,29+,30-,31+,32+,33+,34+,35-,37+,38+,39+,40+,41-,42+,43-,44-,45-,46-,47+,48+,49-,50+/m1/s1 |
InChI Key | YMKWEJBJAVBYHU-SBTGRVASSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H76O21 |
Molecular Weight | 1013.10 g/mol |
Exact Mass | 1012.48790943 g/mol |
Topological Polar Surface Area (TPSA) | 294.00 Ų |
XlogP | 0.60 |
20460-30-4 |
IA1T4AD43K |
Lanatosid E |
Lanatosid E [German] |
UNII-IA1T4AD43K |
BRN 0078457 |
Gitaloxigenin + zuckerkette wie bei lanatosid A |
4-18-00-02468 (Beilstein Handbook Reference) |
Q27280622 |
CARD-20(22)-ENOLIDE, 16-(FORMYLOXY)-3-((O-.BETA.-D-GLUCOPYRANOSYL-(1->4)-O-3-O-ACETYL-2,6-DIDEOXY-.BETA.-D-RIBO-HEXOPYRANOSYL-(1->4)-O-2,6-DIDEOXY-.BETA.-D-RIBO-HEXOPYRANOSYL-(1->4)-2,6-DIDEOXY-.BETA.-D-RIBO-HEXOPYRANOSYL)OXY)-14-HYDROXY-, (3.BETA.,5.BETA.,16.BETA.)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.80% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.14% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 97.75% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.81% | 94.45% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.26% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.22% | 97.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.03% | 85.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.14% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 90.00% | 94.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.07% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 86.94% | 98.95% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.74% | 94.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.11% | 92.50% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 84.63% | 94.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.56% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.22% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.49% | 96.21% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.44% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.43% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.91% | 96.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.77% | 97.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.30% | 91.24% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.40% | 92.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.09% | 94.00% |
CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 80.24% | 92.32% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Digitalis lanata |
PubChem | 15560068 |
LOTUS | LTS0169826 |
wikiData | Q27280622 |