Lamellarin W
| Internal ID | 53920368-88b9-4af2-b546-577f3b1eaf37 |
| Taxonomy | Organoheterocyclic compounds > Pyrroles > Substituted pyrroles > Phenylpyrroles |
| IUPAC Name | 7-hydroxy-12-(3-hydroxy-4-methoxyphenyl)-8,16,17,18-tetramethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C2=C3C4=CC(=C(C(=C4C=CN3C5=C2C6=CC(=C(C=C6OC5=O)O)OC)OC)OC)OC)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C2=C3C4=CC(=C(C(=C4C=CN3C5=C2C6=CC(=C(C=C6OC5=O)O)OC)OC)OC)OC)O |
| InChI | InChI=1S/C30H25NO9/c1-35-20-7-6-14(10-18(20)32)24-25-17-12-22(36-2)19(33)13-21(17)40-30(34)27(25)31-9-8-15-16(26(24)31)11-23(37-3)29(39-5)28(15)38-4/h6-13,32-33H,1-5H3 |
| InChI Key | WIDPXKJPGQIMKM-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C30H25NO9 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 543.15293138 g/mol |
| Topological Polar Surface Area (TPSA) | 117.00 Ų |
| XlogP | 6.00 |
| CHEMBL301410 |
| 189083-85-0 |
| SCHEMBL13766254 |
| DTXSID50172302 |
| BDBM50077361 |
| 3-Hydroxy-13-(3-hydroxy-4-methoxy-phenyl)-2,9,10,11-tetramethoxy-5-oxa-6b-aza-dibenzo[a,i]fluoren-6-one |
| 6H-(1)Benzopyrano(4',3':4,5)pyrolo(2,1-alpha)isoquinolin-6-one, 3-hydroxy-14-(3-hydroxy-4-methoxyphenyl)-2,10,11,12-tetramethoxy- |
| 6H-[1]Benzopyrano[4',3':4,5]pyrolo[2,1-.alpha.]isoquinolin-6-one, 3-hydroxy-14-(3-hydroxy-4-methoxyphenyl)-2,10,11,12-tetramethoxy- |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.29% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.22% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.08% | 91.11% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.76% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.51% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.49% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 94.11% | 98.11% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.63% | 99.15% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.35% | 94.45% |
| CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 89.27% | 95.53% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 87.47% | 80.78% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.44% | 93.03% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.73% | 93.65% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.29% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.98% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.39% | 99.23% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.27% | 86.92% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.18% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.45% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.58% | 96.00% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 80.08% | 93.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5481590 |
| LOTUS | LTS0131874 |
| wikiData | Q83042413 |