Lajollamycin D
| Internal ID | c5be0ecb-f38f-4ec5-9bb3-07dd1c9406df |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | (3R,4Z,6E,8E,10E)-3-hydroxy-N-[(2E,4E,6R,7R,9S)-6-hydroxy-9-[(1R,4S,7R,8S)-8-hydroxy-1,5,7-trimethyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octan-8-yl]-9-methoxy-7-methylnona-2,4-dienyl]-2,2,4,10-tetramethyl-11-nitrododeca-4,6,8,10-tetraenamide |
| SMILES (Canonical) | CC1C(=O)N(C2(C1(C(CC(C)C(C=CC=CCNC(=O)C(C)(C)C(C(=CC=CC=CC(=C(C)[N+](=O)[O-])C)C)O)O)OC)O)C(OC2=O)C)C |
| SMILES (Isomeric) | C[C@H]1C(=O)N([C@]2([C@@]1([C@H](C[C@@H](C)[C@H](/C=C/C=C/CNC(=O)C(C)(C)[C@@H](/C(=C\C=C\C=C\C(=C(/C)\[N+](=O)[O-])\C)/C)O)O)OC)O)[C@H](OC2=O)C)C |
| InChI | InChI=1S/C36H53N3O10/c1-22(26(5)39(46)47)17-13-11-14-18-23(2)30(41)34(7,8)32(43)37-20-16-12-15-19-28(40)24(3)21-29(48-10)36(45)25(4)31(42)38(9)35(36)27(6)49-33(35)44/h11-19,24-25,27-30,40-41,45H,20-21H2,1-10H3,(H,37,43)/b14-11+,16-12+,17-13+,19-15+,23-18-,26-22+/t24-,25+,27-,28+,29+,30-,35-,36-/m1/s1 |
| InChI Key | NSTDWVVCICGULY-ZALZRNDGSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C36H53N3O10 |
| Molecular Weight | 687.80 g/mol |
| Exact Mass | 687.37309490 g/mol |
| Topological Polar Surface Area (TPSA) | 191.00 Ų |
| XlogP | 3.80 |
| (3R,4Z,6E,8E,10E)-3-hydroxy-N-[(2E,4E,6R,7R,9S)-6-hydroxy-9-[(1R,4S,7R,8S)-8-hydroxy-1,5,7-trimethyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octan-8-yl]-9-methoxy-7-methylnona-2,4-dienyl]-2,2,4,10-tetramethyl-11-nitrododeca-4,6,8,10-tetraenamide |
| (3R,4Z,6E,8E,10E)-3-Hydroxy-N-((2E,4E,6R,7R,9S)-6-hydroxy-9-((1R,4S,7R,8S)-8-hydroxy-1,5,7-trimethyl-3,6-dioxo-2-oxa-5-azaspiro(3.4)octan-8-yl)-9-methoxy-7-methylnona-2,4-dien-1-yl)-2,2,4,10-tetramethyl-11-nitrododeca-4,6,8,10-tetraenimidate |
| (3R,4Z,6E,8E,10E)-3-hydroxy-N-((2E,4E,6R,7R,9S)-6-hydroxy-9-((1R,4S,7R,8S)-8-hydroxy-1,5,7-trimethyl-3,6-dioxo-2-oxa-5-azaspiro(3.4)octan-8-yl)-9-methoxy-7-methylnona-2,4-dienyl)-2,2,4,10-tetramethyl-11-nitrododeca-4,6,8,10-tetraenamide |
| (3R,4Z,6E,8E,10E)-3-Hydroxy-N-[(2E,4E,6R,7R,9S)-6-hydroxy-9-[(1R,4S,7R,8S)-8-hydroxy-1,5,7-trimethyl-3,6-dioxo-2-oxa-5-azaspiro[3.4]octan-8-yl]-9-methoxy-7-methylnona-2,4-dien-1-yl]-2,2,4,10-tetramethyl-11-nitrododeca-4,6,8,10-tetraenimidate |
| RefChem:152148 |
| CHEMBL3338259 |
| CHEBI:199912 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.79% | 98.95% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.45% | 97.25% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 94.97% | 94.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 92.23% | 91.07% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.11% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.71% | 89.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 88.98% | 98.59% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.47% | 97.14% |
| CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 88.14% | 80.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.77% | 96.09% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 87.60% | 95.71% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.41% | 96.90% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 87.12% | 92.12% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.61% | 86.92% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.54% | 86.33% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.53% | 94.33% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.21% | 89.34% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 84.57% | 89.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.16% | 100.00% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.73% | 90.08% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 83.42% | 97.47% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 83.24% | 92.88% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.59% | 99.23% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.38% | 91.19% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.46% | 99.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.36% | 93.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.61% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 118715172 |
| LOTUS | LTS0123521 |
| wikiData | Q75068377 |