Lactuside C
Internal ID | e179929e-85c3-4111-bb09-1e35f63e5a4e |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | (3S,3aS,5R,9aS,9bS)-3,6,9-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
SMILES (Canonical) | CC1C2CC(C(=C3C(C2OC1=O)C(=CC3=O)C)C)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]2C[C@H](C(=C3[C@@H]([C@H]2OC1=O)C(=CC3=O)C)C)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H28O9/c1-7-4-11(23)15-9(3)12(5-10-8(2)20(27)30-19(10)14(7)15)28-21-18(26)17(25)16(24)13(6-22)29-21/h4,8,10,12-14,16-19,21-22,24-26H,5-6H2,1-3H3/t8-,10-,12+,13+,14-,16+,17-,18+,19-,21+/m0/s1 |
InChI Key | ZUNQUEPUGDYLCG-NHDJOBCSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H28O9 |
Molecular Weight | 424.40 g/mol |
Exact Mass | 424.17333247 g/mol |
Topological Polar Surface Area (TPSA) | 143.00 Ų |
XlogP | -1.10 |
Lactuside C |
(3S)-5beta-(beta-D-Glucopyranosyloxy)-3,3abeta,4,5,9abeta,9balpha-hexahydro-3beta,6,9-trimethylazuleno[4,5-b]furan-2,7- |
(3S,3aS,5R,9aS,9bS)-3,6,9-trimethyl-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.49% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.47% | 91.11% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 94.00% | 96.61% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.42% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.95% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.70% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.09% | 97.09% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.48% | 86.92% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.15% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.20% | 94.00% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.87% | 94.80% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.05% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lactuca sativa |
Lactuca triangulata |
PubChem | 13893667 |
LOTUS | LTS0164580 |
wikiData | Q105383874 |