Lactaroviolin
| Internal ID | 51c89282-a465-4b77-a037-a51a7f230121 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Guaianes |
| IUPAC Name | 4-methyl-7-prop-1-en-2-ylazulene-1-carbaldehyde |
| SMILES (Canonical) | CC1=C2C=CC(=C2C=C(C=C1)C(=C)C)C=O |
| SMILES (Isomeric) | CC1=C2C=CC(=C2C=C(C=C1)C(=C)C)C=O |
| InChI | InChI=1S/C15H14O/c1-10(2)12-5-4-11(3)14-7-6-13(9-16)15(14)8-12/h4-9H,1H2,2-3H3 |
| InChI Key | PUEUPUYRYIOTKZ-UHFFFAOYSA-N |
| Popularity | 25 references in papers |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.104465066 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 4.10 |
| 85-33-6 |
| 4-methyl-7-prop-1-en-2-ylazulene-1-carbaldehyde |
| C37I306S05 |
| 1-Azulenecarboxaldehyde, 4-methyl-7-(1-methylethenyl)- |
| 7-Isopropenyl-4-methyl-1-Azulenecarboxaldehyde |
| 4-methyl-7-(prop-1-en-2-yl)azulene-1-carbaldehyde |
| CCRIS 3672 |
| Lactaroviloin |
| UNII-C37I306S05 |
| LACTAROVIOLIN [MI] |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.66% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.57% | 98.95% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 94.85% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.63% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.11% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 90.34% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.80% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.48% | 91.11% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.21% | 96.00% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 86.60% | 97.78% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.04% | 99.17% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.05% | 93.40% |
| CHEMBL3194 | P02766 | Transthyretin | 81.63% | 90.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.73% | 89.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.36% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 123595 |
| LOTUS | LTS0111460 |
| wikiData | Q20054531 |