Lactarazulene
| Internal ID | 8fde5f38-e935-404f-8c34-e3b2f6eaffce |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Guaianes |
| IUPAC Name | 1,4-dimethyl-7-prop-1-en-2-ylazulene |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-9H,1H2,2-4H3 |
| InChI Key | KFLXZUPIDNPCSD-UHFFFAOYSA-N |
| Popularity | 23 references in papers |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.125200510 g/mol |
| Topological Polar Surface Area (TPSA) | 0.00 Ų |
| XlogP | 5.00 |
| 489-85-0 |
| 1,4-dimethyl-7-prop-1-en-2-ylazulene |
| GD5E5UK4YX |
| Azulene, 1,4-dimethyl-7-(1-methylethenyl)- |
| Azulene, 7-isopropenyl-1,4-dimethyl- |
| 1,4-Dimethyl-7-(1-methylethenyl)azulene |
| UNII-GD5E5UK4YX |
| Lactarazulen |
| 1,4-Dimethyl-7-isopropenylazulene |
| DTXSID90197635 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.35% | 91.49% |
| CHEMBL260 | Q16539 | MAP kinase p38 alpha | 96.71% | 97.78% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 92.28% | 90.24% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.94% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.31% | 90.00% |
| CHEMBL3961 | Q15759 | MAP kinase p38 beta | 85.62% | 94.75% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.42% | 94.73% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.63% | 97.21% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.41% | 91.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.07% | 93.65% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.07% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 3083592 |
| LOTUS | LTS0222443 |
| wikiData | Q83070445 |