Lachnoisoflavones B
Internal ID | 345145a2-cfb9-40a6-a879-71807e518c12 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavans > Isoflavanones > 6-prenylated isoflavanones |
IUPAC Name | 7,20-dihydroxy-17-prop-1-en-2-yl-10,12,16-trioxapentacyclo[11.7.0.03,11.04,9.015,19]icosa-1(20),3(11),4(9),5,7,13,15(19)-heptaen-2-one |
SMILES (Canonical) | CC(=C)C1CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(O3)OC5=C4C=CC(=C5)O |
SMILES (Isomeric) | CC(=C)C1CC2=C(O1)C=C3C(=C2O)C(=O)C4=C(O3)OC5=C4C=CC(=C5)O |
InChI | InChI=1S/C20H14O6/c1-8(2)12-6-11-14(24-12)7-15-17(18(11)22)19(23)16-10-4-3-9(21)5-13(10)25-20(16)26-15/h3-5,7,12,21-22H,1,6H2,2H3 |
InChI Key | UVJBSWKDLJKBCL-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H14O6 |
Molecular Weight | 350.30 g/mol |
Exact Mass | 350.07903816 g/mol |
Topological Polar Surface Area (TPSA) | 89.10 Ų |
XlogP | 4.80 |
CHEBI:70029 |
Lachnoisoflavone B |
CHEMBL1689271 |
Q27138371 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.15% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.94% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.05% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.65% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.66% | 95.56% |
CHEMBL3401 | O75469 | Pregnane X receptor | 90.67% | 94.73% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 88.99% | 95.62% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 88.39% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.32% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.29% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.41% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.85% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.65% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.36% | 86.33% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.64% | 93.65% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Crotalaria lachnophora |
PubChem | 51041994 |
LOTUS | LTS0027285 |
wikiData | Q27138371 |