2-Isobutyl-5-(3-indolyl)oxazole
| Internal ID | ced8bd05-cb88-4085-96b1-66fbdb858895 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indoles |
| IUPAC Name | 5-(1H-indol-3-yl)-2-(2-methylpropyl)-1,3-oxazole |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H16N2O/c1-10(2)7-15-17-9-14(18-15)12-8-16-13-6-4-3-5-11(12)13/h3-6,8-10,16H,7H2,1-2H3 |
| InChI Key | DJGNEEKCRPWTKI-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 41.80 Ų |
| XlogP | 3.80 |
| 5-(1H-Indol-3-yl)-2-isobutyloxazole |
| 477951-20-5 |
| 5-(1H-indol-3-yl)-2-(2-methylpropyl)-1,3-oxazole |
| CHEMBL464484 |
| SCHEMBL12318442 |
| 2-isobutyl-5-(3-indolyl)oxazole |
| 3-(2-Isobutyl-oxazol-5-yl)-1H-indole |
| 3-(2-isobutyl-1,3-oxazol-5-yl)-1H-indole |
| 1H-indole, 3-[2-(2-methylpropyl)-5-oxazolyl]- |
| InChI=1/C15H16N2O/c1-10(2)7-15-17-9-14(18-15)12-8-16-13-6-4-3-5-11(12)13/h3-6,8-10,16H,7H2,1-2H |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 93.52% | 98.95% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.82% | 94.62% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.44% | 94.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 91.18% | 93.31% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 90.50% | 88.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.01% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 89.77% | 91.11% |
| CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 89.33% | 85.30% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.48% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.23% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.20% | 96.09% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.10% | 95.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.93% | 98.75% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 84.76% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.42% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.23% | 93.99% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 83.57% | 93.81% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 83.18% | 96.67% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 83.14% | 97.79% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.72% | 92.67% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.46% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.92% | 86.33% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 81.65% | 90.17% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.21% | 89.44% |
| CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 80.24% | 88.84% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 637460 |
| LOTUS | LTS0047253 |
| wikiData | Q77281482 |