L-rhodinose-L-rhodinose-2-deoxy-L-fucose-10-decarbomethoxy-epsilon-rhodomycinone
| Internal ID | 76aaad80-70fc-421a-b1c0-bf0de243d504 |
| Taxonomy | Phenylpropanoids and polyketides > Anthracyclines |
| IUPAC Name | (7S,9S)-9-ethyl-4,6,9,11-tetrahydroxy-7-[(2R,4S,5S,6S)-4-hydroxy-5-[(2S,5S,6S)-5-[(2S,5S,6S)-5-hydroxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-6-methyloxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES (Canonical) | CCC1(CC(C2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4O)O)OC5CC(C(C(O5)C)OC6CCC(C(O6)C)OC7CCC(C(O7)C)O)O)O |
| SMILES (Isomeric) | CC[C@]1(C[C@@H](C2=C(C1)C(=C3C(=C2O)C(=O)C4=C(C3=O)C=CC=C4O)O)O[C@H]5C[C@@H]([C@@H]([C@@H](O5)C)O[C@H]6CC[C@@H]([C@@H](O6)C)O[C@H]7CC[C@@H]([C@@H](O7)C)O)O)O |
| InChI | InChI=1S/C38H48O14/c1-5-38(46)14-20-30(36(45)32-31(34(20)43)33(42)19-7-6-8-22(40)29(19)35(32)44)25(15-38)51-28-13-23(41)37(18(4)49-28)52-27-12-10-24(17(3)48-27)50-26-11-9-21(39)16(2)47-26/h6-8,16-18,21,23-28,37,39-41,43,45-46H,5,9-15H2,1-4H3/t16-,17-,18-,21-,23-,24-,25-,26-,27-,28-,37+,38-/m0/s1 |
| InChI Key | JJAQRKNMYZIVJG-UUZPQXLNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C38H48O14 |
| Molecular Weight | 728.80 g/mol |
| Exact Mass | 728.30440620 g/mol |
| Topological Polar Surface Area (TPSA) | 211.00 Ų |
| XlogP | 4.10 |
| L-rhodinose-L-rhodinose-2-deoxy-L-fucose-10-decarbomethoxy-epsilon-rhodomycinone |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.04% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.38% | 97.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.38% | 89.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.72% | 95.93% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 95.18% | 96.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.53% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.69% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.83% | 99.23% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.79% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.48% | 86.33% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.53% | 96.77% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.19% | 91.49% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 88.12% | 97.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.39% | 85.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.05% | 95.89% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.57% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.25% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.03% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.62% | 99.15% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.34% | 94.73% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.86% | 97.14% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 82.37% | 83.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.03% | 85.11% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.88% | 92.62% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.23% | 97.25% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 80.17% | 92.88% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139589979 |
| LOTUS | LTS0052965 |
| wikiData | Q105129494 |