L-Methionyl-L-isoleucine
| Internal ID | 0a91e2b8-dc8a-46f8-ac17-7ceb3ba5598e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)O)NC(=O)C(CCSC)N |
| SMILES (Isomeric) | CC[C@H](C)[C@@H](C(=O)O)NC(=O)[C@H](CCSC)N |
| InChI | InChI=1S/C11H22N2O3S/c1-4-7(2)9(11(15)16)13-10(14)8(12)5-6-17-3/h7-9H,4-6,12H2,1-3H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 |
| InChI Key | OGGRSJFVXREKOR-CIUDSAMLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.13511374 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | -2.20 |
| H-MET-ILE-OH |
| 40883-17-8 |
| Met-Ile |
| Methionyl-Isoleucine |
| 67UNF5G723 |
| (2S,3S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-methylpentanoic acid |
| EINECS 255-129-7 |
| N-L-Methionyl-L-isoleucine |
| (2S,3S)-2-((S)-2-Amino-4-(methylthio)butanamido)-3-methylpentanoic acid |
| L-Met-L-Ile |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.07% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.23% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.70% | 93.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.44% | 96.09% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 91.02% | 92.29% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.98% | 100.00% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 90.70% | 100.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.50% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.70% | 99.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 87.44% | 99.35% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 87.22% | 97.21% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.38% | 89.50% |
| CHEMBL3308 | P55212 | Caspase-6 | 84.58% | 97.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.24% | 90.17% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.48% | 90.71% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.91% | 89.34% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.64% | 91.19% |
| CHEMBL4072 | P07858 | Cathepsin B | 81.77% | 93.67% |
| CHEMBL3776 | Q14790 | Caspase-8 | 81.07% | 97.06% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.12% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Arabidopsis thaliana |
| PubChem | 6451660 |
| LOTUS | LTS0076341 |
| wikiData | Q27144842 |