Leu-Thr
| Internal ID | 6b0a00be-a12b-49b9-aa8c-7ff40a5ea051 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S,3R)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H20N2O4/c1-5(2)4-7(11)9(14)12-8(6(3)13)10(15)16/h5-8,13H,4,11H2,1-3H3,(H,12,14)(H,15,16)/t6-,7+,8+/m1/s1 |
| InChI Key | LRKCBIUDWAXNEG-CSMHCCOUSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14230712 g/mol |
| Topological Polar Surface Area (TPSA) | 113.00 Ų |
| XlogP | -3.20 |
| L-leucyl-L-threonine |
| L-Leu-L-Thr |
| SCHEMBL8527776 |
| CHEBI:73589 |
| LT |
| Q27141903 |
| L-T |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.73% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.88% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.13% | 96.09% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 93.90% | 92.29% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.44% | 93.56% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.17% | 90.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.28% | 100.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.03% | 90.24% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.95% | 89.50% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.28% | 96.95% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.88% | 96.47% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.80% | 90.20% |
| CHEMBL236 | P41143 | Delta opioid receptor | 84.71% | 99.35% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 84.37% | 100.00% |
| CHEMBL3308 | P55212 | Caspase-6 | 83.43% | 97.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.24% | 99.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.11% | 97.21% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.31% | 90.00% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.71% | 98.10% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.14% | 94.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 10353878 |
| LOTUS | LTS0033366 |
| wikiData | Q27141903 |