L-Leucinamide, N-acetyl-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]-
| Internal ID | 4071494d-ad89-4b8f-92e1-851fcef91024 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Dipeptides |
| IUPAC Name | (2S)-2-acetamido-N-[(2S)-1-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
| SMILES (Canonical) | CC(C)CC(C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)C |
| SMILES (Isomeric) | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NC(CCCN=C(N)N)C=O)NC(=O)C |
| InChI | InChI=1S/C20H38N6O4/c1-12(2)9-16(24-14(5)28)19(30)26-17(10-13(3)4)18(29)25-15(11-27)7-6-8-23-20(21)22/h11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,29)(H,26,30)(H4,21,22,23)/t15?,16-,17-/m0/s1 |
| InChI Key | GDBQQVLCIARPGH-BSOSBYQFSA-N |
| Popularity | 920 references in papers |
| Molecular Formula | C20H38N6O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29545371 g/mol |
| Topological Polar Surface Area (TPSA) | 169.00 Ų |
| XlogP | 0.40 |
| RefChem:799003 |
| Leupeptin Ac |
| 24365-47-7 |
| C01591 |
| (2S)-2-acetamido-N-[(2S)-1-[[5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide |
| AC1NR4EG |
| orb1685651 |
| SCHEMBL4669504 |
| CHEBI:226583 |
| CHEBI:582303 |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of L-Leucinamide, N-acetyl-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]-](https://plantaedb.com/storage/docs/compounds/2023/11/l-leucinamide-n-acetyl-l-leucyl-n-4-aminoiminomethylamino-1-formylbutyl-.jpg "2D Structure of L-Leucinamide, N-acetyl-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]-")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.97% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.43% | 98.95% |
| CHEMBL4072 | P07858 | Cathepsin B | 97.23% | 93.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.76% | 96.09% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.17% | 93.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.04% | 98.05% |
| CHEMBL1801 | P00747 | Plasminogen | 93.64% | 92.44% |
| CHEMBL4801 | P29466 | Caspase-1 | 92.81% | 96.85% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 92.17% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.11% | 99.17% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 92.01% | 83.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.62% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.51% | 94.45% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.55% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.20% | 96.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.10% | 96.47% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 87.88% | 95.38% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 86.57% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.07% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 85.91% | 97.29% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 85.52% | 98.33% |
| CHEMBL3308 | P55212 | Caspase-6 | 84.70% | 97.56% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.10% | 95.71% |
| CHEMBL3776 | Q14790 | Caspase-8 | 83.12% | 97.06% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 83.08% | 89.50% |
| CHEMBL2821 | P00748 | Coagulation factor XII | 82.46% | 96.21% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 82.09% | 92.29% |
| CHEMBL3891 | P07384 | Calpain 1 | 81.71% | 93.04% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.67% | 91.19% |
| CHEMBL268 | P43235 | Cathepsin K | 81.54% | 96.85% |
| CHEMBL5028 | O14672 | ADAM10 | 80.73% | 97.50% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.68% | 87.45% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.51% | 94.33% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.34% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5284408 |
| LOTUS | LTS0090338 |
| wikiData | Q105006635 |