L-L-Homoglutathione
| Internal ID | fb0c8e9f-9930-4b06-9f7b-1fadfc92d1d2 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | C(CC(=O)NC(CS)C(=O)NCCC(=O)O)C(C(=O)O)N |
| SMILES (Isomeric) | C(CC(=O)NC(CS)C(=O)NCCC(=O)O)C(C(=O)O)N |
| InChI | InChI=1S/C11H19N3O6S/c12-6(11(19)20)1-2-8(15)14-7(5-21)10(18)13-4-3-9(16)17/h6-7,21H,1-5,12H2,(H,13,18)(H,14,15)(H,16,17)(H,19,20) |
| InChI Key | HKBNQXMLSMKLJV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H19N3O6S |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.09945651 g/mol |
| Topological Polar Surface Area (TPSA) | 160.00 Ų |
| XlogP | -4.60 |
| 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SCHEMBL4653672 |
| CHEBI:187463 |
| 2-amino-5-[[1-(2-carboxyethylamino)-1-oxo-3-sulanylpropan-2-yl]amino]-5-oxopentanoic acid |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.72% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.74% | 98.95% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 96.21% | 92.29% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.78% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.36% | 90.20% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.89% | 90.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 94.19% | 99.35% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.11% | 97.21% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.77% | 96.95% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.14% | 95.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.09% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 89.43% | 100.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.65% | 97.23% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 88.02% | 93.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.91% | 91.11% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.80% | 91.19% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.53% | 94.45% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 82.31% | 96.28% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 82.03% | 82.86% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.59% | 90.71% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 81.52% | 92.26% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.35% | 89.50% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.33% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 81.18% | 97.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Phaseolus vulgaris |
| Vigna radiata |
| PubChem | 3375152 |
| LOTUS | LTS0244526 |
| wikiData | Q105029575 |