L-Gulonic acid
| Internal ID | 57aabbf2-9c41-4eec-941a-74a2232dccaa |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Medium-chain hydroxy acids and derivatives |
| IUPAC Name | (2S,3S,4R,5S)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES (Canonical) | C(C(C(C(C(C(=O)O)O)O)O)O)O |
| SMILES (Isomeric) | C([C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O)O |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3+,4-,5-/m0/s1 |
| InChI Key | RGHNJXZEOKUKBD-QTBDOELSSA-N |
| Popularity | 128 references in papers |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05830272 g/mol |
| Topological Polar Surface Area (TPSA) | 138.00 Ų |
| XlogP | -3.40 |
| Xylosecarboxylic acid |
| Gulonic acid, L- |
| L-gulonate |
| L-Gulonic acid [MI] |
| 526-97-6 |
| UNII-0IK55ZPI0I |
| 0IK55ZPI0I |
| gulonate |
| keto-L-gulonic acid |
| SCHEMBL748759 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.06% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.98% | 96.09% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.85% | 86.92% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.36% | 99.17% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 80.42% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 6857417 |
| LOTUS | LTS0113144 |
| wikiData | Q27453292 |