L-Glutamic acid, 5-[2-(4-formylphenyl)hydrazide]
| Internal ID | ca21ac60-7a3e-4a7e-be21-503687561887 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Glutamine and derivatives |
| IUPAC Name | (2S)-2-amino-5-[2-(4-formylphenyl)hydrazinyl]-5-oxopentanoic acid |
| SMILES (Canonical) | C1=CC(=CC=C1C=O)NNC(=O)CCC(C(=O)O)N |
| SMILES (Isomeric) | C1=CC(=CC=C1C=O)NNC(=O)CC[C@@H](C(=O)O)N |
| InChI | InChI=1S/C12H15N3O4/c13-10(12(18)19)5-6-11(17)15-14-9-3-1-8(7-16)2-4-9/h1-4,7,10,14H,5-6,13H2,(H,15,17)(H,18,19)/t10-/m0/s1 |
| InChI Key | OLPOUQMVOMXOGV-JTQLQIEISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10625597 g/mol |
| Topological Polar Surface Area (TPSA) | 122.00 Ų |
| XlogP | -2.40 |
| L-Glutamic acid, 5-[2-(4-formylphenyl)hydrazide] |
| 114847-20-0 |
![2D Structure of L-Glutamic acid, 5-[2-(4-formylphenyl)hydrazide]](https://plantaedb.com/storage/docs/compounds/2023/11/l-glutamic-acid-5-2-4-formylphenylhydrazide.jpg "2D Structure of L-Glutamic acid, 5-[2-(4-formylphenyl)hydrazide]")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.46% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.60% | 99.17% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.40% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 88.75% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.20% | 91.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 86.77% | 100.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 85.72% | 92.29% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.68% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.67% | 96.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 82.66% | 89.62% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.93% | 91.19% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.85% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.30% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 15382846 |
| LOTUS | LTS0066238 |
| wikiData | Q105194085 |