Kynurenic acid
Internal ID | e2945d19-3a3c-492f-9b94-37dcf44ccf5e |
Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinoline carboxylic acids |
IUPAC Name | 4-oxo-1H-quinoline-2-carboxylic acid |
SMILES (Canonical) | C1=CC=C2C(=C1)C(=O)C=C(N2)C(=O)O |
SMILES (Isomeric) | C1=CC=C2C(=C1)C(=O)C=C(N2)C(=O)O |
InChI | InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14) |
InChI Key | HCZHHEIFKROPDY-UHFFFAOYSA-N |
Popularity | 5,185 references in papers |
Molecular Formula | C10H7NO3 |
Molecular Weight | 189.17 g/mol |
Exact Mass | 189.042593085 g/mol |
Topological Polar Surface Area (TPSA) | 66.40 Ų |
XlogP | 1.30 |
Atomic LogP (AlogP) | 1.23 |
H-Bond Acceptor | 2 |
H-Bond Donor | 2 |
Rotatable Bonds | 1 |
4-Hydroxyquinoline-2-carboxylic acid |
492-27-3 |
13593-94-7 |
Kynurenate |
Transtorine |
4-oxo-1,4-dihydroquinoline-2-carboxylic acid |
Quinurenic acid |
4-Hydroxyquinaldic acid |
4-Hydroxy-2-quinolincarboxylic acid |
Kinurenic acid |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9852 | 98.52% |
Caco-2 | - | 0.5619 | 56.19% |
Blood Brain Barrier | + | 0.6000 | 60.00% |
Human oral bioavailability | + | 0.6571 | 65.71% |
Subcellular localzation | Mitochondria | 0.7434 | 74.34% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.9413 | 94.13% |
OATP1B3 inhibitior | + | 0.9684 | 96.84% |
MATE1 inhibitior | - | 0.9400 | 94.00% |
OCT2 inhibitior | - | 0.9500 | 95.00% |
BSEP inhibitior | - | 0.9238 | 92.38% |
P-glycoprotein inhibitior | - | 0.9818 | 98.18% |
P-glycoprotein substrate | - | 0.9823 | 98.23% |
CYP3A4 substrate | - | 0.6502 | 65.02% |
CYP2C9 substrate | - | 0.6091 | 60.91% |
CYP2D6 substrate | - | 0.9047 | 90.47% |
CYP3A4 inhibition | - | 0.9743 | 97.43% |
CYP2C9 inhibition | - | 0.9070 | 90.70% |
CYP2C19 inhibition | - | 0.9427 | 94.27% |
CYP2D6 inhibition | - | 0.9561 | 95.61% |
CYP1A2 inhibition | - | 0.9046 | 90.46% |
CYP2C8 inhibition | - | 0.8563 | 85.63% |
CYP inhibitory promiscuity | - | 0.9767 | 97.67% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9050 | 90.50% |
Carcinogenicity (trinary) | Non-required | 0.6614 | 66.14% |
Eye corrosion | - | 0.9968 | 99.68% |
Eye irritation | + | 0.9809 | 98.09% |
Skin irritation | - | 0.7663 | 76.63% |
Skin corrosion | - | 0.9821 | 98.21% |
Ames mutagenesis | - | 0.6300 | 63.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.9091 | 90.91% |
Micronuclear | + | 0.8300 | 83.00% |
Hepatotoxicity | + | 0.6698 | 66.98% |
skin sensitisation | - | 0.9006 | 90.06% |
Respiratory toxicity | + | 0.5333 | 53.33% |
Reproductive toxicity | + | 0.5667 | 56.67% |
Mitochondrial toxicity | - | 0.5500 | 55.00% |
Nephrotoxicity | - | 0.6065 | 60.65% |
Acute Oral Toxicity (c) | III | 0.5937 | 59.37% |
Estrogen receptor binding | - | 0.7852 | 78.52% |
Androgen receptor binding | - | 0.4947 | 49.47% |
Thyroid receptor binding | - | 0.6647 | 66.47% |
Glucocorticoid receptor binding | + | 0.6229 | 62.29% |
Aromatase binding | + | 0.6327 | 63.27% |
PPAR gamma | + | 0.5965 | 59.65% |
Honey bee toxicity | - | 0.9691 | 96.91% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | - | 0.7400 | 74.00% |
Fish aquatic toxicity | - | 0.4392 | 43.92% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] |
19952.6 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL3577 | P00352 | Aldehyde dehydrogenase 1A1 |
39810.7 nM |
Potency |
via CMAUP
|
CHEMBL2524 | P06280 | Alpha-galactosidase A |
8912.5 nM |
Potency |
via CMAUP
|
CHEMBL3201 | P35869 | Aryl hydrocarbon receptor |
300 nM 300 nM |
EC50 EC50 |
PMID: 23713606
via Super-PRED |
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
39810.72 nM |
AC50 |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
39810.7 nM 10000 nM 31622.8 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL1293226 | B2RXH2 | Lysine-specific demethylase 4D-like |
28183.8 nM 12589.3 nM 35481.3 nM |
Potency Potency Potency |
via CMAUP
via CMAUP via CMAUP |
CHEMBL2608 | P10253 | Lysosomal alpha-glucosidase |
251.2 nM 251.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL4040 | P28482 | MAP kinase ERK2 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit |
7000 nM |
IC50 |
PMID: 23713606
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.36% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.08% | 95.56% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 93.11% | 94.62% |
CHEMBL2581 | P07339 | Cathepsin D | 91.01% | 98.95% |
CHEMBL2535 | P11166 | Glucose transporter | 88.18% | 98.75% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 87.50% | 94.23% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.80% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.64% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.99% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.49% | 89.00% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.61% | 92.67% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 80.75% | 94.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ephedra foeminea |
Ephedra pachyclada |
Ephedra transitoria |
Hansenia forbesii |
Hansenia weberbaueriana |
Taraxacum coreanum |
Taraxacum mongolicum |
Taraxacum officinale |
Taraxacum platycarpum |
Taraxacum sinicum |
PubChem | 3845 |
NPASS | NPC194562 |
ChEMBL | CHEMBL299155 |
LOTUS | LTS0137555 |
wikiData | Q642217 |